Sản phẩm 100 đô la chỉ với một cú nhấp chuột
Ưu đãi & Giảm giá hàng tháng
Phí giao hàng cố định 199
Sản phẩm 100 đô la chỉ với một cú nhấp chuột
Ưu đãi & Giảm giá hàng tháng
Phí giao hàng cố định 199
Sản phẩm 100 đô la chỉ với một cú nhấp chuột
Ưu đãi & Giảm giá hàng tháng
Phí giao hàng cố định 199
Sản phẩm 100 đô la chỉ với một cú nhấp chuột
Ưu đãi & Giảm giá hàng tháng
Phí giao hàng cố định 199
Sản phẩm 100 đô la chỉ với một cú nhấp chuột
Ưu đãi & Giảm giá hàng tháng
Phí giao hàng cố định 199
Sản phẩm 100 đô la chỉ với một cú nhấp chuột
Ưu đãi & Giảm giá hàng tháng
Phí giao hàng cố định 199
- Tất cả danh mục
Menu chính
-
Về Chúng Tôi
Giỏ hàng của bạn
-
Điện tử & Phụ kiện
-
Máy tính, Văn phòng & Phụ kiện
-
Nhà & Vườn
-
Dụng cụ thú cưng
-
Thể thao & Giải trí
-
Đồ chơi, Trẻ em & Em bé
Menu ngăn kéo
-
Điện tử & Phụ kiện
-
Máy tính, Văn phòng & Phụ kiện
-
Nhà & Vườn
-
Sắc Đẹp & Sức Khỏe
-
Dụng cụ thú cưng
-
Bảo mật
-
Ô tô
-
Thời trang
-
Công nghiệp & Khoa học
-
Thể thao & Giải trí
-
Đồ chơi, Trẻ em & Em bé
Đang giảm giá
Ưu đãi Độc quyền Ngày Thứ Sáu Đen của bạn!
Hưởng giảm thêm 15% cho tất cả mọi thứ — chỉ dành cho bạn.
TỐI ƯU HÓA BF
Ưu đãi Độc quyền Ngày Thứ Sáu Đen của bạn!
Chọn vị trí của bạn
-
Trụ sở Evolution
Miễn phí
Thông thường sẵn sàng để lấy trong 24 giờ
75 Đại lộ 9, New York, NY 10011, Hoa Kỳ
📞 (+1) 212-456-7890
🕐 Thứ Hai – Thứ Sáu: 8:30 sáng – 10:30 tối
Thứ Bảy: 8:30 sáng – 10:30 tối
Chủ Nhật: Đóng cửa -
Chi nhánh Trung tâm thành phố
Nhận hàng trong ngày với 5 đô la
Sẵn sàng trong vòng 6 giờ
240 Broadway, New York, NY 10007, Hoa Kỳ
📞 (+1) 212-987-6543
🕐 Thứ Hai – Chủ Nhật: 9 giờ sáng – 9 giờ tối -
Trung Tâm Dịch Vụ Queens
Miễn phí
Sẵn sàng vào ngày làm việc tiếp theo
89-10 Queens Blvd, Elmhurst, NY 11373, Hoa Kỳ
📞 (+1) 917-555-3344
🕐 Thứ Hai – Thứ Sáu: 9 giờ sáng – 8 giờ tối
Thứ Bảy: 10 giờ sáng – 6 giờ chiều
Chủ Nhật: Đóng cửa
Phụ đề nhỏ
So sánh sản phẩm
Mô tả lưới so sánh sản phẩm của bạn
|
__ __ |
|
|---|---|
| Mô tả |
Mô tả - __ |
| Đánh giá |
Đánh giá - __ |
| Nhà cung cấp |
Nhà cung cấp - __ |
| Màu sắc |
Màu sắc - __ |
|
|
So sánh sản phẩm ( / )
501 sản phẩm
501 sản phẩm
Sắp xếp theo:
- Nổi bật
- Phù hợp nhất
- Bán chạy nhất
- Thứ tự bảng chữ cái (từ A-Z)
- Thứ tự bảng chữ cái (từ Z-A)
- Giá (từ thấp đến cao)
- Giá (từ cao xuống thấp)
- Ngày (từ cũ đến mới)
- Ngày (từ mới đến cũ)
2. GPU: Mali-G610 MC6, LPDDR5 (up to 6400Mbps)
3. OS: Android 14
4. Memory: 12GB + 256GB
5. Micro SD: TF card up to 2TB (not included)
6. Battery: 15600mAh Battery
7. SIM Card Type: Dual Nano SIM Card
8. Material: Aluminum alloy + Plastic +TPU
9. Dimensions: 179x86x25mm
10. Weight: 605g (Add the battery)
Screen Display:
1. Display Size: 6.79 inch
2. Type: TFT LCD, TP incell process
3. IC: NT36672C
4. Glass: Youji
5. Multi-Touch: 10 Points, Multi-point
6. Resolution: 2460 x 1080 pixels
Cameras:
1. Rear Camera: 50MP large chip IMX766 AF + 64MP night vision + 8MP telephoto lens
2. Front Camera: 50MP FF
Network Connectivity:
1. 5G NR: N1/2/3/5/7/8/12/20/25/28/38/40/41/66/77/78
2. 4G FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66; TDD-LTE: B34/38/39/40/41/42
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM850/GSM900/DCS1800/PCS1900MHz
5. Wi-Fi: 802.11 a/b/g/n/ac/ax(2.4GHz/5GHz dual mode)
6. BT: V5.3
7. NFC: Yes, support reading and writing mode, card mode
8. Navigation: GPS, GLONASS, BEIDOU, Galileo
Features:
1. Sensors: Fingerprint identification, Range sensor, 3 in 1 AL&PS sensor, Low G Sensor, Gyro Sensor, PE+ Charger, Compass, Wake-up, Wake up from screen off
2. Camping Light: Yes, Added red and blue warning light design (Two camping lights in different areas, which can be lit at the same time or separately, need 4 control circuits)
3. Projection Function: DLP, resolution 854x480, 100 lumens
4. Support Language: Arabic, Dutch, Czech, Croatian, Danish, French, English, Finnish, Filipino, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Persian, Portuguese, Polish, Russian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian
| General |
|
| Package Weight |
|
Receives in 7 days.
1. Model: XS18 Pro
2. Operating System: Android 9.0
3. CPU: MTK6580, 4 core, 1.3GHz
4. Memory: 2GB RAM, 16GB ROM
5. Extended storage: TF card up to 64GB (not included)
6. Material: Plastic
7. Battery: 900mAh polymer battery, non-removable
8. Display Size: 3.0 inch, 16:9, HD, 480 x 854 pixels
9. Cameras: 5MP rear, 2MP front
10. Network:
A. GSM: 850/900/1800/1900
B. WCDMA: B1/B2/B5/B8
11. SIM card: Nano SIM + Nano SIM / SD Card, choose two from three card trays
12. WiFi: 802.11a/b/g/n 2.4GHz
13. Bluetooth: BT 4.0
14. GPS: Support
15. Sensor: Gravity sensor, ambient light sensor, proximity sensor
16. USB: Type-C
17. Languages: Default English, compatible with Indonesia, Malaysia, German, English, Spanish, Philippines, French, Italy, Persian, Portugal, Vietnam, Turkey, Russian, Arabic, India, Thai, Cambodia, Myanmar etc.
18. Size: 90 x 46.3 x 10.5mm
19. Weight: 65g
Package List
1. Phone x 1
2. Screen Protector x 1
3. Eject Pin x 1
4. Protective Case x 1
5. USB Cable x 1
6. User Manual x 1
| Package Weight |
|
Receives in 7 days.
2. Memory: 12GB RAM LPDDR5X + 512GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 67W wired turbo charging
6. Headphone Port: Type-C
7. SIM Card: Dual SIM, dual standby
8. Sensor: Proximity sensor, ambient light sensor, accelerometer, electronic compass, IR blaster, gyroscope, Z-axis linear vibration motor
9. NFC: Support
10. Security: In-screen, AI Face Unlock
11. Size: 160.45 x 74.34 x 8.25mm
12. Weight: 186g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
Screen:
1. Size: 6.67 inch CrystalRes 1.5K Flow AMOLED DotDisplay
2. Contrast ratio: 5,000,000:1
3. Resolution: 2712 x 1220
4. Pixel Density: 446 PPI
5. Refresh Rate: 120Hz
6. Glass: Corning Gorilla Glass 5
Camera:
1. Rear Camera: 64MP F1.7 + 8MP ultra-wide 120 degrees F2.2 + 2MP macro F2.4
2. Front Camera: 16MP F2.4
Network and Connections:
1. WiFi: 802.11a/b/g/n/ac/ax
2. Network Bands:
A. 5G NSA: N1/3/5/7/8/28/38/40/41/77/78; 5G Sub 6G: N1/2/3/5/7/8/20/28/38/40/41/48/77/78
B. 4G LTE TDD: B38/40/41/48; 4G LTE FDD: B1/2/3/4/5/7/8/18/19/20/28/66 (Narrow Band)
C. 3G WCDMA: B1/2/4/5/6/8/19
D. 2G GSM: 850/900/1800/1900MHz
3. Navigation: GPS: L1, GLONASS: G1, BDS: B1, Galileo: E1, QZSS: L1
4. Bluetooth: BT5.4
Package List
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)
| Package Weight |
|
Receives in 7 days.
1. CPU: Snapdragon 8 Gen 2 Mobile Platform, TSMC 4nm process, octa-core processor, 1 x Cortex-X3 up to 3.19GHz + 2x Cortex-A715 up to 2.8Ghz + 2 x Cortex-A710 up to 2.8Ghz + 3 x Cortex-A510 up to 2.0GHz; GPU: Adreno GPU
2. Memory: 12GB RAM LPDDR5X+ 512GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 120W charging
6. Headphone Port : Type-C
7. SIM Card: Nano SIM + nano SIM
8. Sensor: Proximity sensor, 360 degree ambient light sensor, accelerometer, electronic compass, gyroscope, IR blaster, flicker sensor, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor, AI Face Unlock
11. Size: 160.86 x 74.95 x 8.21mm
12. Weight: 209g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
Screen:
1. Size: 6.67 inch WQHD+ Flow AMOLED
2. Contrast ratio: 5,000,000:1
3. Resolution: 3200 x 1440
4. Pixel Density: 526 PPI
5. Refresh Rate: 120Hz
Camera:
1. Rear Camera: 50MP F1.6 + 8MP ultra-wide F2.2 + 2MP macro F2.4
2. Front Camera: 16MP
3. Features: Front: Night mode, portrait mode, film camera, HDR, palm shutter, time burst; Beauty; Rear: Burst shot mode 2.0, 50MP mode, film camera, documents mode, pro mode, panorama, motion capture, night mode, portrait mode, long exposure, HDR
Network and Connections:
1. WiFi: 802.11a/b/g, 2.4G Wi-Fi, 5G Wi-Fi
2. Network Bands:
A. GSM: B2/3/5/8
B. WCDMA: B1/2/4/5/6/8/19
C. TDD: B38/40/41
D. FDD: B1/2/3/4/5/7/8/18/19/20/28/66
E. 5G Sub 6G: N1/3/5/7/8/20/28/38/40/41/77/78 (5G connectivity may vary based on region availability and local operator support.)
3. Navigation: Beidou: B1I+B1C+B2a, GPS: L1+L5, Galileo: E1+E5a, GLONASS: G1, QZSS: L1+L5, NavIC: L5, AGNSS, Data network, Wireless network, Sensor Assisted Positioning
4. Bluetooth: BT5.3, Dual-Bluetooth
Package List
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)
| Package Weight |
|
Receives in 7 days.
1. CPU: Snapdragon 8 Gen 2 Mobile Platform, TSMC 4nm process, octa-core processor, 1 x Cortex-X3 up to 3.19GHz + 2x Cortex-A715 up to 2.8Ghz + 2 x Cortex-A710 up to 2.8Ghz + 3 x Cortex-A510 up to 2.0GHz; GPU: Adreno GPU
2. Memory: 12GB RAM LPDDR5X+ 256GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 120W charging
6. Headphone Port : Type-C
7. SIM Card: Nano SIM + nano SIM
8. Sensor: Proximity sensor, 360 degree ambient light sensor, accelerometer, electronic compass, gyroscope, IR blaster, flicker sensor, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor, AI Face Unlock
11. Size: 160.86 x 74.95 x 8.21mm
12. Weight: 209g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
Screen:
1. Size: 6.67 inch WQHD+ Flow AMOLED
2. Contrast ratio: 5,000,000:1
3. Resolution: 3200 x 1440
4. Pixel Density: 526 PPI
5. Refresh Rate: 120Hz
Camera:
1. Rear Camera: 50MP F1.6 + 8MP ultra-wide F2.2 + 2MP macro F2.4
2. Front Camera: 16MP
3. Features: Front: Night mode, portrait mode, film camera, HDR, palm shutter, time burst; Beauty; Rear: Burst shot mode 2.0, 50MP mode, film camera, documents mode, pro mode, panorama, motion capture, night mode, portrait mode, long exposure, HDR
Network and Connections:
1. WiFi: 802.11a/b/g, 2.4G Wi-Fi, 5G Wi-Fi
2. Network Bands:
A. GSM: B2/3/5/8
B. WCDMA: B1/2/4/5/6/8/19
C. TDD: B38/40/41
D. FDD: B1/2/3/4/5/7/8/18/19/20/28/66
E. 5G Sub 6G: N1/3/5/7/8/20/28/38/40/41/77/78 (5G connectivity may vary based on region availability and local operator support.)
3. Navigation: Beidou: B1I+B1C+B2a, GPS: L1+L5, Galileo: E1+E5a, GLONASS: G1, QZSS: L1+L5, NavIC: L5, AGNSS, Data network, Wireless network, Sensor Assisted Positioning
4. Bluetooth: BT5.3, Dual-Bluetooth
Package List
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)
| Package Weight |
|
Receives in 7 days.
2. Memory: 12GB RAM LPDDR5X+ 512GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 90W turbo charging
6. Headphone Port : Type-C
7. SIM Card: Dual SIM, dual standby
8. Sensor: Proximity sensor, ambient light sensor, accelerometer, electronic compass, IR blaster, Gyroscope, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor, AI Face Unlock
11. Size: 160.5 x 74.4 x 7.8mm
12. Weight: 179g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
Screen:
1. Size: 6.67 inch
2. Contrast ratio: 5,000,000:1
3. Pixel: 2712 x 1220
4. Pixel Density: 466 PPI
5. Refresh Rate: 120Hz
6. Glass: Corning Gorilla Glass Victus
Camera:
1. Rear Camera: 50MP IMX882 F1.59 + 8MP ultra-wide camera IMX355
2. Front Camera: 20MP OV20B F2.2
Network and connections:
1. WiFi: 802.11a/b/g/n/ac/ax
2. Network Bands:
A. GSM: 850/900/1800/1900MHz
B. WCDMA: B1/2/4/5/6/8/19
C. TDD: B38/40/41/42/48
D. FDD: B1/2/3/4/5/7/8/18/19/20/26/28/66
E. 5G Sub 6G: N1/2/3/5/7/8/20/28/38/40/41/48/66/77/78; 5G NSA: N1/3/5/7/8/20/28/38/40/41/66/77/78(5G connectivity may vary based on region availability and local operator support.)
3. Navigation: GPS: L1, GLONASS: G1, Beidou: B1, Galileo E1, QZSS L1
4. Bluetooth: BT5.4
Package Contents:
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)
| Package Weight |
|
Receives in 7 days.
2. Memory: 8GB RAM LPDDR5X+ 256GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 90W turbo charging
6. Headphone Port : Type-C
7. SIM Card: Dual SIM, dual standby
8. Sensor: Proximity sensor, ambient light sensor, accelerometer, electronic compass, IR blaster, Gyroscope, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor, AI Face Unlock
11. Size: 160.5 x 74.4 x 7.8mm
12. Weight: 179g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
Screen:
1. Size: 6.67 inch
2. Contrast ratio: 5,000,000:1
3. Pixel: 2712 x 1220
4. Pixel Density: 466 PPI
5. Refresh Rate: 120Hz
6. Glass: Corning Gorilla Glass Victus
Camera:
1. Rear Camera: 50MP IMX882 F1.59 + 8MP ultra-wide camera IMX355
2. Front Camera: 20MP OV20B F2.2
3. Features: Front: Portrait, Beauty; Rear: HDR, Panorama Mode, Portrait, Monochrome Mode, Depth, Beauty, AI
Network and connections:
1. WiFi: 802.11a/b/g/n/ac/ax
2. Network Bands:
A. GSM: 850/900/1800/1900MHz
B. WCDMA: B1/2/4/5/6/8/19
C. TDD: B38/40/41/42/48
D. FDD: B1/2/3/4/5/7/8/18/19/20/26/28/66
E. 5G Sub 6G: N1/2/3/5/7/8/20/28/38/40/41/48/66/77/78; 5G NSA: N1/3/5/7/8/20/28/38/40/41/66/77/78(5G connectivity may vary based on region availability and local operator support.)
3. Navigation: GPS: L1, GLONASS: G1, Beidou: B1, Galileo E1, QZSS L1
4. Bluetooth: BT5.4
Package Contents:
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)
| Package Weight |
|
Receives in 7 days.
2. Memory: 4GB (+8GB virtual RAM) + 256GB ROM, support TF card up to 2TB (not included)
3. Operating System: Android 14
4. Battery capacity: 6500mAh polymer battery
5. Charging: Type-C, 18W
6. Headphone Port : Type-C
7. SIM Card: Nano+Nano/Nano+TF
8. Sensor: Fingerprint, G-sensor, Proximity Sensor, Ambient Light Senor, Compass, Hard Coulometer
9. Features: Support FM, OTG, NFC
10. Language: English, Spanish, Portuguese (Brazil), Portuguese (Portugal), Italian, German, French, Russian, Arabic, Malay, Thai, Greek, Ukrainian, Croatian, Czech, Simplified Chinese, traditional Chinese
11. Size: 172.2 x 80 x 12.4mm
12. Weight: 281g
13. Protection level: IP68 (immerse in 1.5m water for up to 30 minutes), IP69K, MIL-STD-810H
Screen:
1. Size: 6.6-inch
2. Screen-to-body ratio: 89%
3. Pixel: 720x1612
4. Pixel Density: 268 PPI
5. Refresh Rate: 60Hz
6. Glass: Corning Gorilla Glass 5
Camera:
1. Rear Camera: 48MP F1.79 OV48B2Q-GA5A + 0.3MP depth + 2MP macro F2.4
2. Front Camera: 8MP F2.2 IMX314
3. Features: Front: Portrait, Beauty; Rear: HDR, Panorama Mode, Portrait, Monochrome Mode, Depth, Beauty, AI
Network and connections:
1. WiFi: IEEE802.11 a/b/g/n/ac 2.4/5G
2. Network Bands:
A. GSM: B2/B3/B5/B8
B. WCDMA: B1/2/4/5/8/19
C. TDD: B34/B38/39/40/41F(HPUE)
D. FDD: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28AB/66/71
E. 5G SA: N1/2/3/5/7/8/20/28/38/40/41/66/71/77/78; 5G NSA: N1/2/3/5/7/8/20/28/38/40/41/66/71/77/78
F. Support 4G VoLTE
3. Navigation: GPS+GLONASS+Beidou+Galileo
4. Sensors: Gravity sensor, gyroscope, proximity sensor, ambient light sensor, compass (magnetic), geomagnetism, near field communication
5. Bluetooth: BT5.2
Package Contents:
1. Phone x 1
2. Power Adapter x 1
3. USB Cable x 1
4. Ejector Tool x 1
5. Protective Film x 1
6. User Manual x 1
7. Warranty Card x 1
| Package Weight |
|
Receives in 7 days.
1. CPU: MediaTek Dimensity 6300, octa-core, 2.4GHz, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 1.0GHz
3. Memory: 12GB LPDDR4X +12GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.2
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 14
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector 2.0: uSmart Expansion Connector, supporting uSmart series accessories. And the type-C port allows charging while the uSmart Connector working.
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button + SOS Key, Left: Custom Key
10. Battery: 10600mAh Li-ion sub-zero solid-state battery
11. Charge: 33W, 20V/6A, Support 5W reverse charging
12. Wireless Charge: Support, 30W, 16V1.5A, Ulefone private protocol
13. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
14. Digital Toolbox: Height Meter, Compass, Gradienter, Flashlight, Hanging Painting, Magnifier, Alarm bell, Plumb bob, Protractor, Noise Test, Pedometer, Barometer, Funny Sound, Underwater Camera
15. Pre-installed APP: Google Assistant, Calculator, Google Calendar, Camera, Children Space, Chrome, Cleaning Assisitant, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Freezer, Gallery, Game Mode, Gmail, Google, Google TV, Keep Notes, Google Maps, Google Meet, Google Messages, Mobile Guardian, MyFLIR, NFC Access Card, Outdoor Toolkit, Phone, Google Photos, Google Play Store, Remote Control, Safety, Service Center, Settings, SIM ToolKit, Sound Recorder, Theme, Widget Box, YouTube, YT Music
16. Language: Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Korean, Burmese, Japanese, Simplified Chinese, Traditional Chinese
17. Dimensions: 182.8 x 86.8 x 18.5 mm
18. Weight: 441g
Display Screen
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 85%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9
Camera
1. Rear Camera: 50MP Main Rear Camera (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95 large aperture) + 64MP Night Vision Camera (OV64B1B CMOS sensor, FOV 79.4 degrees, F1.79 large aperture) + Ultra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 large aperture)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45 large aperture)
3. Rear camera photography features: Normal mode, Night vision mode, Film mode, 50MP mode, Night mode, Document correction, GroupPhoto, AI Emoji, Gif, Portrait, Sports, Pro mode, Panorama, Slow motion, Time lapse, Intelligent acanning
4. Front camera photography features: Normal mode, Film mode, GroupPhoto, AI Emoji, Gif, Portrait
Network & Connection
Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR
Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning: GPS/GLONASS/Beidou/Galileo/QZSS
4. NFC: Yes
5. OTG Function: Support, reverse charging
6. FM Radio: Support, headset-free FM radio
7. IR Blaster: Support
Package List
1. Phone x 1
2. AC Power Charger, 33W x 1
3. Type-C to Type-C Data Cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
1. CPU: MediaTek Helio G99 2.2GHz, octa-core, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 1.0GH
3. Memory: 6GB LPDDR4X +6GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.1
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 14
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Thermal Sensor, Infrared sensor
7. Digital Toolbox: Compass, SoundMeter, Pic Hanging, Gradienter, HeightMeasure, Magnifier, Protractor, Plumb bob, Alarm bell, Pedometer, Barometer, FunnySound, Torch, Mirror
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Battery: 6500mAh li-ion polymer battery
10. Charge: 33W, 11V3A, Support 5W reverse charging
11. Wireless Charge: Support, 30W, 16V1.5A, Ulefone private protocol
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 177.4 x 81.4 x 12.5 mm
14. Weight: 326g
Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 86%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9
Cameras:
1. Rear Camera: 50MP Main Rear Camera (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95 large aperture) + 64MP Night Vision Camera (OV64B1B CMOS sensor, FOV 79.4 degrees, F1.79 large aperture)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45 large aperture)
3. Rear camera photography features: Normal mode, Night Vision Mode, Night Mode, Beauty Mode, 50MP Mode, Pro Mode, Portrait, Gif, Panorama, Slow Motion, Mono, Bokeh, QR Code
4. Front camera photography features: Normal mode, Beauty Mode, Portrait, Gif, Mono
Network Bands:
1.4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support VoLTE
Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning:GPS/GLONASS/Beidou/Galileo/QZSS
4. NFC: Support
5. OTG Function: Support
Thermal Imaging
1. App: ThermoVue
2. Resolution: 160 x 120
3. Refresh Rate: 25Hz
4. Pixel Pitch: 12um
5. NETD: Less than 50mK at 25 degree C, F#1.0, 25Hz
6. Temperature Measurement: -20 degree C to 550 degree C
7. Accuracy: 3 degree C
Other Specifications
Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese
Pre-installed APP:
Google Assistant, Calculator, Google Calendar, Camera, Child mode, Chrome, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Game Mode, Gmail, Google, Google Maps, Google Meet, Google Messages, Phone, Google Photos, Google Play Store, QRCode Scan, Remote Control, Safety, Service Center, Settings, SIM ToolKit, Sound Recorder, System Manager, ThermoVue, Toolbag, Youtube, YT Music
Package List
1. Phone x 1
2. AC Power Charger 33W x 1
3. Type-C to Type-C Data cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1
15. Thermal Imaging User Manual Access Guide x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
2. GPU: Mali-G57 MC2 1.0GHz
3. Memory: 12GB(plus 12GB virtual memory can be extended to 24GB)+512GB
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector: uSmart Expansion Connector, supporting uSmart series accessories.
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button + SOS Key,Left: Custom Key
10. Battery: 15600mAh li-ion polymer battery
11. Charge: 120W, 20V/6A, Support 10W reverse charging
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 179 x 83 x 25.5 mm
14. Weight: 600g
Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 84%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9
Cameras:
1. Rear Camera: 200MP Main Rear Camera (HP3 CMOS sensor, 0.56um, 7 piece lens, FOV 84.7 degrees, F1.79 large aperture) +
64MP Night Vision Camera (OV64B1B CMOS sensor, F1.79 large aperture) + 50MPUltra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 large aperture) 8MP 3.2X Optical Zoom Telephoto Lens (Hi847 CMOS sensor, 3.2X Optical Zoom, 30x Digital Zoom, Supports Zoom EIS)
2. Front camera: 50MP(Hi5022Q CMOS sensor, 1.0um, 5 piece lens, FOV 80.4 degree, F2.25 large aperture)
3. Rear camera photography features: Normal mode, Night Vision Mode, Film Mode, 200MP Mode, Night Mode, Gif, Portrait, Pro Mode, Panorama, Slow Motion, Time Lapse, Macro, Intelligent Scanning
4. Front camera photography features: Normal mode, Film, Gif, Portrait
Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR
Wireless Transmission:
1. Wi-Fi: 2.4G/5G/WiFi 6, 802.11 ax/ac/a/b/g/n
2. BT: V5.1
3. GPS Positioning: (L1+L5) GPS/GLONASS/Beidou/Galileo/QZSSCompass
4. NFC: Yes
5. OTG Function: Support, max 27W (9V3A) reverse charging
Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese
Pre-installed APP:
Google Assistant, Calculator, Google Calendar, Camera, Children Space, Chrome, Cleaning Assistant, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Funny Sound, Game Booster, Gmail, Google, Google TV, Lenscase, Google Maps, Google Meet, Google Messages, Mobile Guardian, Outdoor Toolbox, Phone, Google Photos, Google Play Store, PrizeInterPhone, Remote Control, Safety, Service Center, Settings, SIM Toolkit, Sound Recorder, Theme, Widget Box, Youtube, YT Music
Package List:
1. Phone x 1
2. AC Power Charger x 1
3. Type-C to Type-C Data cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x
| General |
|
| Package Weight |
|
Receives in 7 days.
2. GPU: Mali-G57 MC2 1.0GHz
3. Memory: 12GB(plus 12GB virtual memory can be extended to 24GB)+512GB
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector: uSmart Expansion Connector, supporting uSmart series accessories.
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button + SOS Key,Left: Custom Key(default PTT Key)
10. Battery: 15600mAh li-ion polymer battery
11. Charge: 120W, 20V/6A, Support 10W reverse charging
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 179 x 83 x 25.5 mm
14. Weight: 600g
Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 84%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9
Cameras:
1. Rear Camera: 200MP Main Rear Camera (HP3 CMOS sensor, 0.56um, 7 piece lens, FOV 84.7 degrees, F1.79 large aperture) + 64MP Night Vision Camera (OV64B1B CMOS sensor, F1.79 large aperture) + 50MPUltra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 large aperture) 8MP 3.2X Optical Zoom Telephoto Lens (Hi847 CMOS sensor, 3.2X Optical Zoom, 30x Digital Zoom, Supports Zoom EIS)
2. Front camera: 50MP(Hi5022Q CMOS sensor, 1.0um, 5 piece lens, FOV 80.4 degree, F2.25 large aperture)
3. Rear camera photography features: Normal mode, Night Vision Mode, Film Mode, 200MP Mode, Night Mode, Gif, Portrait, Pro Mode, Panorama, Slow Motion, Time Lapse, Macro, Intelligent Scanning
4. Front camera photography features: Normal mode, Film, Gif, Portrait
Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR
Wireless Transmission:
1. Wi-Fi: 2.4G/5G/WiFi 6, 802.11 ax/ac/a/b/g/n
2. BT: V5.1
3. GPS Positioning: (L1+L5) GPS/GLONASS/Beidou/Galileo/QZSS Compass
4. NFC: Yes
5. OTG Function: Support, max 27W (9V3A) reverse charging
Radio Communication:
1. Type: Dual-mode (digital/analog) dual-band (UHF/VHF), dual-slot, support DMR
2. Frequency Range: UHF Band: 400MHz-470MHz; VHF Band: 137MHz-172MHz
3. Operating Range: UHF Band: 0-22KM; VHF Band: 0-30KM
4. App: PrizeInterPhone
5. Shortcut Key: PTT Key (One-key to talk)
Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese
Pre-installed APP:
Google Assistant, Calculator, Google Calendar, Camera, Children Space, Chrome, Cleaning Assistant, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Funny Sound, Game Booster, Gmail, Google, Google TV, Lenscase, Google Maps, Google Meet, Google Messages, Mobile Guardian, Outdoor Toolbox, Phone, Google Photos, Google Play Store, PrizeInterPhone, Remote Control, Safety, Service Center, Settings, SIM Toolkit, Sound Recorder, Theme, Widget Box, Youtube, YT Music
Package List:
1. Phone x 1
2. Detachable Antenna (UHF+VHF ) x 2
3. AC Power Charger x 1
4. Type-C to Type-C Data cable (100cm) x 1
5. Protective Film (Pre-installed) x 1
6. Tempered Glass Screen Protector x 1
7. SIM Needle x 1
8. Lanyard x 1
9. Multi-language User Manual x 1
10. Multi Function Instruction Card x 1
11. Walkie-Talkie User Guides x 1
12. Warranty Card x 1
13. Charging Instruction Card x 1
14. Safety Prompt Card x 1
15. Accessories Ecosystem Brochure x 1
16. Service Center APP Instructions x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
2. GPU: G57 650MHz
3. Memory: 4GB+128GB
4. Storage Extend: TF card up to 1TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Light Sensor, G-Sensor, side-mounted fingerprint
7. Sim-card type: Two nano card
8. Charge Port: Type-C
9. Dimensions: 166.2 x 76.5 x 8.7mm
10. Weight: 235g
Display Screen:
1. Size: 6.6 inch
2. Screen to Body Ratio: 91.5%
3. Multi-touch: 10 points
4. Screen resolution: 1612 x 720
5. Aspect Ratio: 20:09
6. PPI: 273
7. Glass: Panda
8. Refresh Rate: 90Hz
Cameras:
1. Rear Camera: 50MP OV50C40 1/2.5 inch F1.8, 78.83 degree FOV + 0.08MP GC6133
2. Front camera: 16MP S5K3P3 1/3.1 inch F2.2
Network Bands:
1. 4G: FDD-LTE B1/B3/B5/B7/B8/B20/B28AB/B66
2. 3G: WCDMA B1/B2/B5/B8
3. 2G: GSM B2/B3/B5/B8
Battery:
1. Battery Capacity: 5160mAh
2. Standby Time: 1000 hours
3. Talk Time: 4 hours
4. Music Play Time: 60 hours
5. Charger Power: 10W
Wireless Transmission:
1. Wi-Fi: 802.11a/b/g/n, 2.4GHz/5.0GHz
2. BT: BT5.0
3. GPS Positioning: Beidou, Galileo, Glonass, GPS
4. OTG: Yes
Languages:
Arabic, Afrikaans, Bengali, Burmese, Czech, Catalan, Dutch, Danish, English, French, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Khmer, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Armenian, Zulu, Swahili, Slovak, Slovenian
Package List:
1. Phone x 1
2. Screen Protector (pre-applied) x 1
3. Type-C Cable x 1
4. Power Adapter x 1
5. Quick Start Guide x 1
6. OTG Cable x 1
7. Phone Case x 1
(Note: Subject to actual product)
| Package Weight |
|
Receives in 7 days.
2. Operating system: HarmonyOS 4.2
3. CPU: Kirin 9010 7 nm, Octa-core (1x2.3 GHz Taishan Big & 3x2.18 GHz Taishan Mid & 4x1.55 GHz Cortex-A510)
4. Storage RAM+ROM: 16GB+512GB / 16GB+1TB (optional)
5. Dual SIM: Dual SIM, dual standby
6. SIM card type: Card slot 1: Nano SIM card Card slot 2: Nano SIM card
7. Data cable interface: Type-C, USB 3.1 GEN1
8. Headphone interface: Type-C
9. Waterproof and dustproof: IP68 Waterproof for daily life
10. Sensors: Ambient light sensor, infrared sensor, fingerprint sensor (in-screen fingerprint), Hall sensor, gyroscope, compass, NFC, proximity light sensor, gravity sensor, attitude sensor, Camera laser focus sensor, multispectral sensor
11. Body size: 162.6 x 75.1 x 8.4mm
12. Body weight: about 226g (including battery)
Screen:
1. Screen size: 6.8 inch
2. Screen color gamut: 1.07 billion colors, P3 wide color gamut
3. Glass material: Basalt Tempered Kunlun Glass
4. Screen type: OLED, support 1-120Hz LTPO adaptive refresh rate, 1440Hz high-frequency PWM dimming, 300Hz touch sampling rate
5. Screen resolution: FHD+ 2844 × 1260 pixels
6. Touch screen: Multi-touch, 10 points touch
Camera:
1. Dual rear cameras: 50MP super-concentrating retractable camera (1 inch, F1.6~F4.0 aperture, sensor shift anti-shake) + 40MP ultra-wide-angle camera (F2.2 aperture) + 50MP super-concentrating macro telephoto camera (F2.1 aperture) , OIS optical image stabilization), support autofocus
2. Front camera: 13MP ultra-wide-angle camera (F2.4 aperture, AF)
3. Rear camera: Wind speed flash, high-definition mode, intelligent variable aperture, adjustable physical aperture, super night scene, super macro, macro video, video HDR Vivid, macro picture-in-picture, telephoto picture-in-picture, microfilm, audio zoom, high-pixel mode, delay photography, ultra-wide angle, large aperture blur, dual-scene recording, portrait mode, professional mode, slow motion, panorama mode, flowing light shutter, intelligent filter, multi-camera setup, watermark, document correction, AI photography master, dynamic photos, 4D predictive autofocus, smile capture, voice control photography, timed photography, burst mode.Front camera: Video HDR Vivid, slow motion, eye tracking autofocus, intelligent wide-angle switching, portrait mode, panorama mode, delay photography, dynamic photos, intelligent filters, watermark, smile capture, selfie mirror, voice control photography, timed photography.
(Note: Video pixels in different shooting modes may be different, please refer to the actual situation.)
Battery:
1. Battery type: Lithium-ion polymer battery
2. Battery capacity: 5200mAh (typical value)
3. Charger: USB-A port: Support 5V2A or 10V4A or 11V6A Max or 20V5A Max output; USB-C port: Support 5V3A or 9V3A or 10V4A or 11V6A Max or 12V3A or 15V3A Max or 20V5A Max output
4. Theoretical charging time: About 0.6 hours
5. Fast charging function: Wired charging: 100W, 18W reverse charging. Wireless charging: 80W, 20W wireless reverse charging.
6. Wireless charging: Support 50W Huawei wireless super fast charging, 20W wireless reverse charging.
Data Connections:
1. WLAN protocol: 802.11 a/b/g/n/ac/ax, 2x2 MIMO, HE160, 1024QAM, 8 Spatial-stream Sounding MU-MIMO
2. WLAN frequency: 2.4GHz and 5GHz
3. WLAN direct connection: Supported
4. Bluetooth: BT5.2, support SBC, AAC, supports LDAC and L2HC high-definition audio
5. OTG: Support (Maximum output current 2A/9V during reverse power supply)
6. GPS: Support GPS (L1 + L5 dual-band) / AGPS / GLONASS / Beidou ((B1I+B1C+B2a+B2b quad-band) / GALILEO (E1 + E5a + E5b triple-band) / QZSS (L1 + L5 dual-band) / NavIC
Languages:
Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai , Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
Packing List:
1. Mobile phone x 1
2. Eject Pin x 1
3. Protective case x 1
4. Type-C USB cable x 1
5. US power adapter x 1
(Note: Subject to actual product)
| Package Weight |
|
Receives in 7 days.
1. Chipset: MT 8788
2. CPU: A73 2.0GHZx4+A55 2.0GHZx4, 12nm
3. GPU: Mail-G72 800MHz
4. OS: Android 13.0
Memory:
1. RAM: 6GB + 6GB virtual RAM
2. ROM: 256GB
3. T-flash Card: Up to 2TB (not included)
Display Screen:
1. Size: 6.6 inch
2. Type: INCELL
3. Resolution: 1080 x 2460
4. Screen Brightness: 450/480 nits
5. Aspect Ratio: 19.5:9
6. Contrast: 1500
Netwrok:
1. 2G: B2/B3/B5/B8
2. 3G: B1/B2/B5/B8
3. 4G: FDD: B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B66; TDD: B41
Body
1. SIM: Two SIM / nano
2. Dimensions: 176.6x84.8x26.5mm
3. Weight: 550g
4. Build: Front cover: In mold injection hardware
5. Back cover: Plastic
6. Middle frame decoration: Aluminum alloy
7. Side key: Aluminum alloy
Cameras:
1. Front Camera: 16MP S5K3P3SP 1/2 inch F2.2, 80 degree Wide Angle
2. Rear Camera: 64MP IMX686 PDAF 1/2 inch F1.8, 80 degree Wide Angle
3. Rear Sub Camera: 24MP night vision FF 1/2.8 inch F1.8, 80 degree Wide Angle
Battery:
1. Capacity: 20800mAh polymer
2. Standby time: 2500H
3. Talk time: 120H
4. Music Play time: 200H
5. Charging Power: 9V 3A
Others:
1. Features: Fingerprint ID, Face ID, GPS (GPS+GLONASS+Galileo), Wi-Fi(2.4+5G, WLAN Hotspot), Bluetooth(V4.2), FM, OTG, NFC
2. Sensors: G-sensor, Proximity Sensor, Ambient Light Senor, Compass (magnetic), Geomagnetism, Hard Coulometer, Rapid Charge, Sound Amplifier, Smart Gesture, Air Gesture
3. Video Playback: Support AVI, MP4, WMV, RMVB, MKV, MOV, ASF, RM, FLV and other video formats, up to 1080p / 30fps
4. Audioplayer: Support MP3, M4A, AAC, MKA, AMRAnd other video formats / supports lossless format: ALAC(Apple Lossless), FLAC, APE, WAV
5. Graphic Format: Support JPEG, BMP, GIF, PNG etc.
6. Language: Arabic, Bengali, Bulgarian, Burmese, Dutch, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hindi, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Norwegian, Persian, Portuguese, Polish, Romanian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Swahili, Lithuanian, Slovak, Slovenian, Bosnian
Package List:
1. Phone x 1
2. User Manual x 1
3. USB Cable x 1
4. Warranty Card x 1
5. EU Plug Power Adapter x 1
6. Package Box x 1
| Package Weight |
|
Receives in 7 days.
4.407.000 VND
1. Chipset: MT 8788
2. CPU: A73 2.0GHZx4+A55 2.0GHZx4
3. GPU: Mail-G72 800MHz
4. OS: Android 13.0
Memory:
1. RAM: 4GB + 4GB virtual RAM
2. ROM:128GB
3. T-flash Card: Up to 2TB (not included)
Display Screen:
1. Size: 6.52 inch
2. Type: INCELL
3. Resolution: 720 x 1280
4. Screen Brightness: 420/450 nits
5. Aspect Ratio: 19.5:9
6. Contrast: 1500
Netwrok:
1. 2G: B2/B3/B5/B8
2. 3G: B1/B2/B4/B5/B6/B8/B19
3. 4G: FDD: B1/B2/B3/B4/B5/B7/B8/ B12/B13/B17/B18/B19/B20/B26/B28A/ B28B/B66; TDD: B38/B39/B40/B41
Body:
1. SIM: Two SIM / nano
2. Dimensions: 174.6x82.8x12.8mm
3. Weight: 310g
4. Build: Front cover: In mold injection hardware
5. Back cover: Plastic
6. Middle frame decoration: Aluminum alloy
7. Side key: Aluminum alloy
Cameras:
1. Front Camera: 8MP HI849 FF 1/5 inch F2.4, 80 degree Wide Angle
2. Rear Camera: 20MP IMX220 PDAF 1/2.3 inch F1.8, 80 degree Wide Angle
Battery:
1. Capacity: 6280mAh polymer
2. Standby time: 1200H
3. Talk time: 30H
4. Music Play time: 65H
5. Charging Power: 5V2A
Others:
1. Features: Face ID, GPS (GPS+GLONASS+Galileo), Wi-Fi(2.4+5G, WLAN Hotspot), Bluetooth(V5.0), FM, OTG,
2. Sensors: G-sensor, Proximity Sensor, Ambient Light Senor, Compass (magnetic), Hard Coulometer, Rapid Charge, Sound Amplifier, Smart Gesture, Air Gesture
3. Video Playback: Support AVI, MP4, WMV, RMVB, MKV, MOV, ASF, RM, FLV and other video formats, up to 1080p / 30fps
4. Audioplayer: Support MP3, M4A, AAC, MKA, AMRAnd other video formats / supports lossless format: ALAC(Apple Lossless), FLAC, APE, WAV
5. Graphic Format: Support JPEG, BMP, GIF,PNG etc.
6. Language: Arabic, Bengali, Bulgarian, Burmese, Dutch, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hindi, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Norwegian, Persian, Portuguese, Polish, Romanian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Swahili, Lithuanian, Slovak, Slovenian, Bosnian
Package List:
1. Phone x 1
2. User Manual x 1
3. USB Cable x 1
4. Warranty Card x 1
5. EU Plug Power Adapter x 1
6. Package Box x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
1. CPU: Dimensity 8200
2. OS: Android 13
3. Memory: 16GB+512GB / 18GB+512GB LPDDR4 (optional)
4. 16GB+16GB Virtual RAM up to 32GB / 18GB + 18GB Virtual RAM up to 36GB
5. Micro SD: TF card up to 2TB (not included)
6. Battery: Non-Removable 23800mAh Battery
7. SIM Card Type: Dual Nano SIM Card
8. Material: Aluminum alloy + Plastic +TPU
9. Dimensions: 179x86x29.8mm
10. Weight: 696g (Add the battery)
Screen Display:
1. Display Size: 6.79 inch
2. Resolution: 2460 x 1080 pixels
3. Refresh Rate:120Hz
Cameras:
1. Rear Camera: 200MP AF + 64MP night vision + 50MP wide Angle
2. Front Camera: 50MP FF
Network Connectivity:
1. 5G NR: N1/N2/N3/N5/N7/N8/N12/N20/N25/N28/N38/N40/N41/N66/N77/N78
2. 4G FDD-LTE: B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B66; TDD-LTE: B34/B38/B39/B40/B41/B42
3. 3G WCDMA: B1/B2/B4/B5/B6/B8/B19
4. 2G GSM B2/B3/B5/B8
5. Wi-Fi: Wi-Fi 6
6. Bluetooth: Bluetooth 5.3
7. NFC: Yes, support reading and writing mode, card mode
8. Navigation: GPS(L1+L5)+GLONASS+Beidou+Galileo
Languages:
English, Spanish, Portuguese (Brazil), Portuguese (Portugal), Italian, German, French, Russian, Arabic, Malay, Thai, Greek, Ukrainian, Croatian, Czech, Simplified Chinese, Traditional Chinese.(It has updated 48 languages)
| General |
|
| Package Weight |
|
Receives in 7 days.
2. GPU: Arm Mali G57
3. Storage and memory: 4GB (4GB + 8GB Virtual Extended to 12GB) +128GB
4. Phone Storage Card: Up to 1TB(Not included)
5. Battery capacity: 6300mAh battery, 900 hours standby time, 45 hours calling time
6. Charging Power: 10W, Reverse Charging
7. Charging interface: Type-C charging interface
8. OTG: Yes
9. Operating system: Android 13.0
10. Languages: Arabic, Bengali, Bulgarian, Burmese, Dutch, Croatian, Catalan, Czech, Danish, English, French, Filipino, Finnish, Greek, German, Hungarian, Hindi, Hebrew, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish , Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Kazakh, Urdu, Armenian, Estonian, Lithuanian, Slovak, Slovenian
11. Sensor: G-sensor, Gyroscope, Ambient Light Senor, Compass (magnetic), Sound Amplifier, NFC
12. Size: 81.5x166.4x15.4mm
13. Weight: 300g
Screen:
1. Size: 5.93-inch FHD+ display
2. Resolution: 720 x 1440, 271 PPI
3. Brightness: 440 nits
4. Aspect Ratio: 18:9
5. Screen-to-Body Ratio: 74%
Cameras:
1. Rear Cameras: 20MP F1.8 PDAF
2. Front Camera: 5MP F2.4
3. Functions: Rear: Panorama, Beauty; Front: Beauty, Monochrome Mode
Network and connections:
1. 4G FDD: B1/B2/B3/B4/B5/B7/B8/B12/B17/B19/B20/B25/B26/B28AB/B66;
2. 4G TDD: B34/B38/B39/B40/B41
3. 3G WCDMA: B1/B2/B4/B5/B8
4. 2G GSM: B2/B3/B5/B8
5. SIM Card Mode: Nano+Nano / Nano+TF Card
6. WiFi: 802.11 a/b/g/n/ac (2.4G+5G)
7. Bluetooth: BT5.0
8. Support NFC
9. Navigation: GPS, GLONASS, Galileo, Beidou
10. Support 4G VoLTE
Package Contents:
1. Rugged Phone x 1
2. USB Cable x 1
3. Power Adapter x 1
4. Quick Start Guide x 1
5. Warranty Card x 1
6. User Manual x 1
7. Protective Film x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
2. OS System: RTOS
3. Memory: ROM 128MB + RAM 48MB
4. Storage Extend: TF card up to 64GB (not included)
5. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
6. Charge Port: Type-C
7. Battery: 2000mAh li-ion removable battery
8. Features: FM Radio, SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 146.2x65.4x17mm
12. Weight: 390g
Display Screen:
1. Size: 2.8 inch QVGA TFT screen
2. Screen resolution: 320 x 240 px
Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
(Note: Different versions correspond to different frequency bands)
Languages:
1. EU Version: English, Chinese, Arabic, Portuguese, Russian, Greek, French, Italian, Turkish, Spanish, German, Hebrew, Czech, Dutch, Albanian, Bulgarian, Croatian, Danish, Finnish, Macedonian , Norwegian, Polish, Serbian, Swedish, Hungarian
2. US Version: Chinese, English, Portuguese, French, Spanish, Dutch
(Note: Different versions have different corresponding languages.)
Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide(In 6 languages ??(English, German, Greek, Polish, Russian, Hungarian)) x 1
6. Lock-pin x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
1. CPU: MT6789 / Helio G99, 2xARM Cortex-A76 2.2GHz + 6xARM Cortex-A55 2.0GHz
2. GPU: Up to of LPDDR4X-4266 SDRAM (2 channels,one 16-bit data bus for each)
3. OS: Android 13
4. Memory: 8GB + 256GB
5. Micro SD: TF card up to 2TB (not included)
6. Battery: Non-Removable 5800mAh Battery
7. SIM Card Type: Dual Nano SIM Card
8. Material: Aluminum alloy + Plastic
9. Dimensions: 58.8x120.7x23.3mm
10. Weight: 240g
Screen Display:
1. Display Size: 4.3 inch
2. Type: TFT LCD
3. Resolution: 1200 x 540 pixels
Cameras:
1. Rear Camera: 100MP main AF
2. Front Camera: 32MP FF
Network Connectivity:
1. 4G FDD-LTE: B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B66; TDD-LTE: B34/B38/B39/B40/B41
2. 3G WCDMA: B1/B2/B4/B5/B6/B8
3. 2G GSM: B2/B3/B5/B8
4. Wi-Fi: Support 802.11 a/b/g/n/ac(2.4GHz/5GHz dual mode), support WI-FI Direct connection,WI-FI Display(the screen is wirelessly transmitted to other devices device), WI-FI hotspot(V2.0)
5. Bluetooth: Bluetooth 5.3
6. NFC: Yes
7. Navigation: GPS, GLONASS, BEIDOU, Galileo
Features:
1. Sensors: Fingerprint identification(not support fingerprint payment), Range sensor, 3 in 1 AL&PS sensor, Low G Sensor, Gyro Sensor, 33W PE+ Charger, Compass, Wake-up, Wake up from screen off
2. Camping Light: Yes, Added red and blue warning light design (Two camping lights in different areas, which can be lit at the same time or separately, need 4 control circuits)
3. Support Language: Arabic, Dutch, Czech, Croatian, Danish, French, English, Finnish, Filipino, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Persian, Portuguese, Polish, Russian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian
Packing List:
1. Mobile Phone x 1
2. Eject Pin x 1
3. USB Cable x 1
4. Charging Power Adapter x 1
(The actual product shall prevail)
| General |
|
| Package Weight |
|
Receives in 7 days.
2. Memory: ROM 128MB + RAM 48MB
3. Storage Extend: TF card up to 64GB (not included)
4. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
5. Charge Port: Type-C
6. Headphone Jack: 3.5mm
7. Battery: 1500mAh li-ion removable battery
8. Features: FM Radio, OTG (reverse charging), SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 107.3 x 56.2 x 20.3mm
Display Screen:
1. Size: 2.8 inch inner screen, 1.77 inch outer screen
2. Screen resolution: 240 x 320 px inner screen,160 x 128px outer screen
Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
Languages:
1. European languages: Finnish, Swedish, Norwegian, Icelandic, Danish, Spanish, Portuguese, Italian, Greek, Slovenian, Croatian, Romanian, Bulgarian, Serbian, English, French, Irish , Dutch, German, Swiss, Polish, Czech, Hungarian, Slovak, Estonian, Latvian, Lithuanian, Russian
2. US language: Costa Rican, Cuban, Honduran, Canadian English, US English, Mexican, Dominican, Grenadian, Haitian, Nicaraguan, Salvadoran, Saint Kitts and Nevis, Saint Lucia English, Saint Vincent and the Grenadines, Trinidad and Tobago, Guatemalan, Jamaican
Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
2. GPU: Arm Mali-G77 836MHz
3. Memory: 12GB(Plus 12GB virtual memory can be extended to 24GB) + 512GB
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity sensor, gravity sensor, Light sensor, acceleration sensor, geomagnetic sensor, gyro sensor, coulomb counter, pedometer, air pressure sensor, infrared sensor
7. Card Type: Nano+Nano+microSD
8. Charge Port: Type-C, USB 3.1 Gen 1 (Device: USB 3.1 Gen 1, Host: USB 2.0)
9. Headphone Jack: 3.5mm
10. Battery: 5280mAh li-polymer battery
11. Charge: 120W, 20V/6A fast charging, support 50W wireless charging
12. Unlock Options: Fingerprint Unlock, Face Unlock
13. FM Radio: Support, headset-free
14. Digital Toolbox: Height meter, compass, gradienter, flashlight, hanging painting, magnifier, alarm bell, plumb bob, protractor, noise test, pedometer, barometer
15. Material: PC
16. Size: 177.4 x 81.5 x 12.75 mm
17. Weight: 332 grams
Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Multi-touch: 10
4. Screen resolution: 1080 x 2460 FHD+
5. PPI: 396
6. Screen-to-Body Ratio: 86%
7. Ratio: 20.5:9
8. Color Depth: 8bit, 16.7M
Cameras:
1. Rear Camera: 50MP Main (S5KGN1 CMOS sensor, 1.2um, 7 piece lens, FOV 84.7 degree, F1.65 large aperture) + 64MP Night Vision (OV64B1B CMOS sensor, F1.79 aperture) + 50MP ultra wide-angle (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 aperture) + 8MP 3.2X optical zoom telephoto lens (Hi847 CMOS sensor, 3.2X-30X focal length)
2. Front camera: 50MP (Hi5022Q CMOS sensor, 1.0um, 5 piece lens, FOV 80.4 degrees, F2.25 large aperture)
3. Rear camera photography features: Normal mode, night vision mode, film mode, 50MP mode, night mode, gif, portrait, pro mode, panorama, slow motion, time lapse, macro, intelligent scanning
4. Front camera photography features: Normal mode, film, 50MP, gif, portrait
Network Bands:
1. 5G NR Sub6: N1/N2/N3/N5/N7/N8/N20/N25/N28/N38/N40/N41/N66/N71/N77/N78/N79
2. 4G: FDD-LTE: B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B66/B71; TDD-LTE: B34/B38/B39/B40/B41
3. 3G WCDMA: B1/B2/B4/B5/B6/B8/B19
4. 2G GSM: B2/B3/B5/B8
Connectivity:
1. Wi-Fi: 2.4G/5G, 802.11 a/b/g/n/ac/ax, support Wi-Fi 6
2. BT: V5.1
3. GPS Positioning: GPS (L1+L5 Dual Band) + Glonass + BeiDou + Galileo
4. NFC: Support
5. OTG : Support
Satellite Communication:
1. Type: Two-way Satellite Messaging (send and receive text messages, share location, SOS via satellite)
2. App: Bullitt Satellite Messenger
3. Satellite Service Operator: Empowered by Bullitt
4. Satelite Network Operator: Powered by Skyko
5. Satellite Coverage: Albania, Andorra, Austria, Belarus, Belgium, Bosnia and Herzegovina, Bulgaria, Channel Island, Croatia, Cyprus, Czech Republic, Denmark, Estonia, Finland, France, Germany, Gibraltar, Greece, Holy See, Hungary, Ireland, Isle of Man, Italy, Latvia, Liechtenstein, Lithuania, Luxembourg, Malta, Moldova, Monaco, Montenegro, Netherlands, North, Macedonia, Norway, Poland, Portugal, Romania, San Marino, Serbia, Slovakia, Slovenia, Spain, Sweden, Switzerland, United Kingdom, Canada, United States (Please check https://bullitt.com/coverage/ for coverage maps)
Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Korean, Burmese, Japanese, Simplified Chinese, Traditional Chinese and others
Package List:
1. Phone x 1
2. AC power charger (100~240V /EU plug) x 1
3. Type-C Data cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM needle x 1
7. Lanyard x 1
8. Multi-language user manual x 1
9. Multi Function Instruction card x 1
10. Bullitt Satellite Messengger User Guide x 1
11. Warranty card x 1
12. Charging Instruction card x 1
13. Safety Prompt card x 1
14. Accesories Ecosystem Brochure x 1
15. Service Center Instructions x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
2. Memory Capacity: 4GB+128GB / 6GB+128GB / 8GB+256GB optional
3. RAM+ROM: LPDDR4X + UFS 2.2
4. Operating System: MIUI 14
5. Sensors: Ambient light sensor, acceleration sensor, virtual gyroscope, electronic compass, infrared remote control, virtual distance sensor
6. SIM Card Slots: Nano-SIM + Nano-SIM or Nano-SIM + micro-SD
7. Charging Interface: Type-C
8. Headphone Jack: 3.5mm
9. Dimensions: 168.05 x 77.91 x 8.19mm
10. Weight: 195g
Screen Display:
1. Screen size: 6.74 inch
2. Screen type/material: LCD
3. Screen ratio: 20.6:9
4. Resolution: 2460 x 1080px
5. Screen refresh rate: 90Hz
6. Touch sampling rate: 180Hz
7. Contrast: 1500:1
8. Features: Double Rheinland eye protection certification
Battery:
1. Battery capacity: 5000mAh
2. Charging power: 18W wired charging
Cameras:
1. Rear camera: 50MP ultra-clear main camera + 2MP depth camera
2. Front camera: 5MP
3. Photo functions: Rear camera photo functions: Super night scene, HDR, 10x digital zoom, portrait mode, movie mode, timed continuous shooting, 50MP mode, film camera; Front camera photo functions: Timed continuous shooting, AI beauty, portrait mode, movie mode, HDR, countdown, screen fill light, gesture selfie
4. Video shooting : 1080P 30fps, 720P 30fps video recording, time-lapse photography
Network Band:
1. 4G: FDD-LTE: B1/B3/B5/B8; TDD-LTE: B34/B38/B39/B40/B41
3. 3G WCDMA: B1/B5/B8
4. 2G GSM: B3/B5/B8
Wireless Network:
1. WiFi: 2.4GHz & 5GHz
2. Bluetooth: V5.3
3. Navigation positioning: GPS, Beidou, Galileo, GLONASS
4. Support multi-function NFC
Media:
1. Audio: MP3, FLAC, APE, M4A, AAC, OGG, WAV, AMR, AWB
2. Video : MP4, M4V, 3GP, 3G2, MKV, WEBM
Language: English, Simple Chinese, Traditional Chinese
Packing List:
1. Mobile phone x 1
2. Eject Pin x 1
3. Protective case x 1
4. USB cable x 1
5. US charging head x 1
6. Pre-attached protective film x 1
(The actual product shall prevail)
| Package Weight |
|
Receives in 7 days.
2. Storage and memory: 8GB+256GB
3. Battery capacity: 22000mAh battery
4. Charging interface: Type-C charging interface
5. 33W PD charging
6. Audio: Type-C headphone jack
7. Identity verification: fingerprint sensor, AI face unlocking
8. NFC: Yes
9. Operating system: Android 13.0
10. Languages: Arabic, Bengali, Bulgarian, Burmese, Dutch, Croatian, Catalan, Czech, Danish, English, French, Filipino, Finnish, Greek, German, Hungarian, Hindi, Hebrew, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish , Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Kazakh, Urdu, Armenian, Estonian, Lithuanian, Slovak, Slovenian
11. Size: 178.1x84x27.5mm
Screen:
1. 6.8-inch FHD+ display
2. 1080x2460,396ppi
3. Refresh rate: up to 120Hz
4. Ratio: 20.5:9
rear camera:
1. 64MP main camera (S5K lens, f/1.8) + 2MP Macro lens (F2.4) + 20MP (F1.8) IMX350 night vision lens
2. Front camera: 16MP front camera
3. The front camera with a large sensor helps you capture the look you want at any time
Network and connections:
1. 2G: GSM:2/3/5/8
2. 3G: WCDMA:1/2/4/5/8
3. 4G: TDD:38/40/41
4. 4G: FDD:1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28AB/66
5. Dual SIM+microSD
6. Support Google Pay and NFC
7. Navigation: GPS, GLONASS, Galileo, Beidou
8. Support 4G VoLTE
Package Contents:
1. Mobile phone x 1
2. Power adapter x 1
3. USB Type-C cable x 1
4. SIM popup tool x 1
5. Quick Start Guide x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
1. Ultra slim and lightweight body.
2. MTK6737 Quad core CPU, high performance, combine with 2GB+16GB memory, run fast and operate smoothly..
3. 3.0 inch screen, 326PPI, 854x480px resolution display.
4. 4MP front camera, 6MP rear cameras take high quality pictures.
5. Built-in 1000mAh polymer battery non-removable battery, the battery will make the phone last for several days in normal use.
Specifications
General:
1. Model: XS15 Pro
2. CPU: MTK6737 Quad Core
3. Memory: 2GB+16GB
4. SIM Quantity: Dual SIM, Nano SIM Card
5. OS System: Android 9.0
6. External Memory: TF card up to 128GB (not included)
7. Support Language: Arabic, Burmese, Cambodian, English, French, Filipino, German, India, Indonesian, Italian, Malay, Persian, Portuguese, Russian, Spanish, Turkish, Thai, Vietnamese
8. Battery Capacity: 1000mAh
9. Battery Types: Undetachable, Li-polymer Battery
10. Other Features: calculator, alarm clock, calendar, memo, timer on/off, keyboard lock, U disk function
11. Size: 94x47.4x12.5mm
Network Connection:
1. 3G: WCDMA 850(B5)/900(B8)/1900(B2)/2100(B1)MHz
2. 2G: GSM 850/900/1800/1900MHz
3. Type: WCDMA, GSM
4. WIFI:802.11a/b/g/n, 2.4GHz
5. BT:Yes, V4.0
Screen Display:
1. Screen Size: 3.0 inch
2. Screen Type: Capacitive
3. Resolution: 854 x 480 pixels
4. PPI: 326PPI
Cameras:
1. Front Camera: 4MP
2. Back Camera: 6MP
3. Video recording: Yes
Connectivity Ports:
1. USB Charging Port: Type C
2. 2 x Nano SIM card or (1 x Nano SIM card + 1 x TF card) slots
Package List
1. Phone x 1
2. Screen Protector x 1
3. Eject Pin x 1
4. Protective Case x 1
5. USB Cable x 1
6. Manual x 1
| Package Weight |
|
Receives in 7 days.
1. Processor: Qualcomm 3nd generation Snapdragon 8 TSMC 4nm octa-core processor, up to 3.3GHz
2. GPU: Adreno
3. Memory capacity: 12GB+256GB / 16GB+512GB / 16GB+1TB optional
4. RAM: LPDDR5X; ROM: UFS 4.0
5. Operating system: Xiaomi HyperOS
6. Sensors: Proximity sensor, under-screen ambient light (color temperature) sensor, rear ambient light (color temperature) sensor, acceleration sensor, gyroscope, electronic compass, X-axis linear motor, infrared remote control, flicker sensor, laser focus sensor, barometer
Screen Display:
1. Screen: 6.73 inch 2K AMOLED super visual sense screen, 3200 x 1440, 12bit
3. Refresh rate: 120Hz
4. Sampling rate: 240Hz, instantaneous 2160Hz
2. Features: Professional primary color screen, LTPO, 12bit, DCI-P3, Classic eye protection, Paper eye protection, Rhythm eye protection, Super dynamic display, Front and rear dual light sense, Sunshine Screen, Auto Brightness 2.0, AI Master Image Quality Engine, Under-screen Fingerprint, Dark Light Unlock, Heart Rate Detection, HDR10+, HDR Vivid, Dolby Vision
Battery:
1. Battery capacity: 4880mAh
2. Charging power: 120W wired fast charging
3. Fast charging: Support QC4 / QC3+ / QC3.0 / QC2.0 / PD3.0 / PD2.0 fast charging protocol + MI FC 2.0 fast charging; 120W Xiaomi Hyperwired second charge / 50W Xiaomi Hyper wireless second charge / wireless reverse charging
4. Charging interface: USB Type-C double-sided charging interface
Camera:
1. Rear camera:
- 50MP Leica super dynamic main camera (Light Hunter 900 custom image sensor, large photosensitive element, f/1.42 - f/4.0 1024-level variable aperture, equivalent to 23mm focal length, supports four-in-one 2.4um large pixel output, supports OIS optics Anti-shake, 7P coating;
- Leica 75mm floating telephoto: f/2.0 aperture, 75mm equivalent focal length, 10cm~infinity focusing distance, supports OIS optical image stabilization, supports Zoom EIS image stabilization
- 50MP Leica ultra-wide angle: f/2.2 large aperture, 14mm equivalent focal length, 115-degree ultra-wide viewing angle, AF autofocus
2. Front camera: 32MP
3. Photo functions: Rear: Leica native dual image quality, movie mode, Dolby Vision, master lens package, everything tracking, sound source tracking, radio type, sports capture, short video recording, portrait mode, panorama mode, cute shooting, professional mode, Time-lapse photography, Super Night Scene 2.0, front and rear dual scenes, document mode, VLOG video, super moon, slow motion shooting, AI watermark, long exposure, AI magic kaleidoscope, AI camera, portrait blur adjustment, AI beauty, ultra-wide angle edge Distortion correction, ID photocopying mode, voice subtitles, video filters, video beautification, video super anti-shake, dynamic photos, countdown photo, level meter, timed continuous shooting, face detection, HDR, custom watermark, voice-activated photo; Front: Dolby Vision, short video recording, portrait mode, front and rear dual scenes, time-lapse photography, cute shooting, voice subtitles, video filters, countdown photography, AI smart beauty, portrait blur adjustment, dynamic photos, timed continuous shooting , voice-activated photo taking
Network Band:
1. 5G: N1/N3/N5/N7/N8/N28A (uplink: 703MHz-733MHz, downlink: 758MHz-788MHz)/N38/N40/N41/N48/N66/N77/N78/N79
2. 4G:
- FDD-LTE: B1/B3/B4/B5/B7/B8/B18/B19/B26/B28A/B66
- TDD-LTE: B34/B38/B39/B40/B41 (2496-2690 194MHz)/B42/B48
3. 3G: WCDMA: B1/B4/B5/B6/B8/B19
4. 2G: GSM: B3/B5/B8
(Note: The actual network and frequency band usage depends on the deployment of local operators. The N3 frequency band needs to be supported by software upgrades after the operator releases it)
Wireless Network:
1. WiFi: supports Wi-Fi 5, Wi-Fi 6, Wi-Fi 4 and 802.11a/b/g; 2.4G Wi-Fi, 5G Wi-Fi
2. Bluetooth: Bluetooth 5.4, Dual-Bluetooth, support AAC/AptX/AptX HD/AptX Adaptive/LDAC/LHDC 5.0
3. Navigation positioning: Beidou: B1I + B1C+ B2a, GPS: L1 + L5, Galileo: E1 + E5a, GLONASS: G1, QZSS: L1 + L5, NavIC: L5, AGNSS, data network positioning, network positioning, sensor assisted positioning
4. Support multi-function NFC
Media:
1. Audio: MP3, FLAC, APE, AAC, OGG, WAV, AMR, AWB, Hi-Res & Hi-Res Audio Wireless certification, stereo dual speakers, Dolby Atmos, spatial audio, audio sharing, real-time ear monitor, WeChat/QQ calling Recording, HD Recording 2.0
2. Video: Support high dynamic range display for MP4, MKV, WEBM, 3GP, HDR 10, HDR 10+, Dolby Vision video content
Exterior:
1. Dimensions: 161.4 x 75.3 x 8.49mm
2. Weight: 223g
3. Buttons: Power button, volume button
4. Charging interface: Type-C
5. SIM card slot: Dual Nano-SIM card slot
Language: English, Simple Chinese, Traditional Chinese
Packing List:
1. Mobile Phone x 1
2. Eject Pin x 1
3. Protective Case x 1
4. USB Cable x 1
5. US Plug Charging Power Adapter x 1
6. Pre-attached Protective Film x 1
(The actual product shall prevail)
| Package Weight |
|
Receives in 7 days.
1. Processor: Qualcomm 3nd generation Snapdragon 8 TSMC 4nm octa-core processor, up to 3.3GHz
2. GPU: Adreno
3. Memory capacity: 12GB+256GB / 16GB+512GB / 16GB+1TB optional
4. RAM: LPDDR5X; ROM: UFS 4.0
5. Operating system: Xiaomi HyperOS
6. Sensors: Proximity sensor, under-screen ambient light (color temperature) sensor, rear ambient light (color temperature) sensor, acceleration sensor, gyroscope, electronic compass, X-axis linear motor, infrared remote control, flicker sensor, laser focus sensor, barometer
Screen Display:
1. Screen: 6.36 inch 1.5K OLED super vision flexible straight screen, 2670 x 1200, 12bit
3. Refresh rate: 120Hz
4. Sampling rate: 240Hz, instantaneous 2160Hz
2. Features: Professional primary color screen, LTPO, 12bit, DCI-P3, Classic eye protection, Paper eye protection, Rhythm eye protection, Super dynamic display, Front and rear dual light sense, Sunshine Screen, Auto Brightness 2.0, AI Master Image Quality Engine, Under-screen Fingerprint, Dark Light Unlock, Heart Rate Detection, HDR10+, HDR Vivid|Dolby Vision
Battery:
1. Battery capacity: 4610mAh
2. Charging power: 90W wired fast charging
3. Fast charging: Support QC4 / QC3+ / QC3.0 / QC2.0 / PD3.0 / PD2.0 fast charging protocol / MI FC 2.0 fast charging; 90W Xiaomi Hyperwired second charge / 50W Xiaomi Hyper wireless second charge / wireless reverse charging
4. Charging interface: USB Type-C double-sided charging interface
Camera:
1. Rear camera:
- 50MP Leica super dynamic main camera: Light Hunter 900 custom image sensor, large photosensitive element, f/1.6 large aperture, 23mm equivalent focal length, supports four-in-one 2.4um large pixel output, supports OIS optical image stabilization, 7P coating
- 32MP Leica 75mm floating telephoto: f/2.0 large aperture, 75mm equivalent focal length, 10cm~infinity focusing distance,
Support OIS optical image stabilization, support Zoom EIS image stabilization
- 50MP Leica ultra-wide angle: f/2.2 large aperture, 14mm equivalent focal length, 115-degree ultra-wide viewing angle
2. Front camera: 32MP
3. Photo functions: Rear: Leica native dual-image quality, movie mode, Dolby Vision, master lens package, everything tracking, sound source tracking, radio type, sports capture, short video recording, portrait mode, panorama mode, cute shooting, professional mode, Time-lapse photography, Super Night Scene 2.0, front and rear dual scenes, document mode, VLOG video, super moon, slow motion shooting, AI watermark, long exposure, AI magic kaleidoscope, AI camera, portrait blur adjustment, AI beauty, ultra-wide angle edge Distortion correction, ID photocopy mode, voice subtitles, video filters, video beautification, video super anti-shake, dynamic photos, countdown photo, level meter, timed continuous shooting, face detection, HDR, custom watermark, voice-activated photo; front Settings: Dolby Vision, short video recording, portrait mode, front and rear dual scenes, time-lapse photography, cute shooting, voice subtitles, video filters, countdown photography, AI smart beauty, portrait blur adjustment, dynamic photos, timed continuous shooting , voice-activated photo taking
Network Band:
1. 5G: N1/N3/N5/N8/N28A (uplink: 703MHz-733MHz, downlink: 758MHz-788MHz)/N38/N40/N41/N48/N66/N77/N78
2. 4G:
- FDD-LTE: B1/B3/B4/B5/B8/B18/B19/B26/B28a/B66
- TDD-LTE: B34/B38/B39/B40/B41(2496-2690 194MHz)/B42/B48
3. 3G: WCDMA: B1/B4/B5/B6/B8/B19
4. 2G: GSM: B3/B5/B8
(Note: The actual network and frequency band usage depends on the deployment of local operators. The N3 frequency band needs to be supported by software upgrades after the operator releases it)
Wireless Network:
1. WiFi: supports Wi-Fi 5, Wi-Fi 6, Wi-Fi 4 and 802.11a/b/g; 2.4G Wi-Fi, 5G Wi-Fi
2. Bluetooth: Bluetooth 5.4, Dual-Bluetooth, support AAC/AptX/AptX HD/AptX Adaptive/LDAC/LHDC 5.0
3. Navigation positioning: Beidou: B1I + B1C+ B2a, GPS: L1 + L5, Galileo: E1 + E5a, GLONASS: G1, QZSS: L1 + L5, NavIC: L5, AGNSS, data network positioning, network positioning, sensor assisted positioning
4. Support multi-function NFC
Media:
1. Audio: MP3, FLAC, APE, AAC, OGG, WAV, AMR, AWB, Hi-Res & Hi-Res Audio Wireless certification, stereo dual speakers, Dolby Atmos, spatial audio, audio sharing, real-time ear monitor, WeChat/QQ calling Recording, HD Recording 2.0
2. Video: Support high dynamic range display for MP4, MKV, WEBM, 3GP, HDR 10, HDR 10+, Dolby Vision video content
Exterior:
1. Dimensions: 152.8 x 71.5 x 8.20-8.28mm
2. Weight: 188-193g
3. Buttons: Power button, volume button
4. Charging interface: Type-C
5. SIM card slot: Dual Nano-SIM card slot
Language: English, Simple Chinese, Traditional Chinese
Packing List:
1. Mobile Phone x 1
2. Eject Pin x 1
3. Protective Case x 1
4. USB Cable x 1
5. US Plug Charging Power Adapter x 1
6. Pre-attached Protective Film x 1
(The actual product shall prevail)
| Package Weight |
|
Receives in 7 days.
3.924.000 VND
2. GPU: G57 650MHz
3. Memory: 8GB+256GB
4. Storage Extend: TF card up to 1TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Light Sensor, G-Sensor, fingerprint
7. Sim-card type: Two nano card
8. Charge Port: Type-C
9. Dimensions: 166.2 x 76.5 x 8.9mm
10. Weight: 236g
Display Screen:
1. Size: 6.6 inch
2. Screen to Body Ratio: 91.5%
3. Multi-touch: 10 points
4. Screen resolution: 1612 x 720
5. Aspect Ratio: 20:09
6. PPI: 273
7. Glass: AGC
Cameras:
1. Rear Camera: 50MP OV50C40 1/2.5 inch F1.8 78.83 degree FOV + 0.08MP GC6133
2. Front camera: 16MP S5K3P3 1/3.1 inch F2.2
Network Bands:
1. 4G:
- FDD-LTE B1/B3/B5/B7/B8/B20/B28AB/B66
- TDD-LTE B38/B39/B40/B41
2. 3G: WCDMA B1/B2/B5/B8
3. 2G: GSM B2/B3/B5/B8
Battery:
1. Battery Capacity: 5160mAh
2. Standby Time: 1000 hours
3. Talk Time: 4 hours
4. Music Play Time: 60 hours
5. Charger: 9V 2A
Wireless Transmission:
1. Wi-Fi: 802.11a/b/g/n, 2.4GHz/5.0GHz
2. BT: BT5.0
3. GPS Positioning: Beidou, Galileo, Glonass, GPS
4. OTG: Yes
Languages:
Arabic, Afrikaans, Bengali, Burmese, Czech, Catalan, Dutch, Danish, English, French, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Khmer, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Armenian, Zulu, Swahili, Slovak, Slovenian
Package List:
1. Phone x 1
2. Screen Protector (pre-applied) x 1
3. Type-C Cable x 1
4. Power Adapter x 1
5. Quick Start Guide x 1
6. OTG Cable x 1
(Note: Subject to actual product)
| Package Weight |
|
Receives in 7 days.
2. GPU: IMG GE8300 770MHz
3. Memory: 3GB+32GB
4. Storage Extend: TF card up to 256GB (not included)
5. Operating system: Android 13 Go
6. Sensor: Acceleration Sensor, Gravity sensor, Light sensor, Proximity sensor, Geomagnetic sensor, E-compassr
7. Sim-card type: Two nano card
8. Charge Port: Type-C
9. Headphone Jack: 3.5mm
10. Battery: 4860mAh
11. Charge: 5W charging
12. Unlock Options: Face Unlock
13. Dimensions: 157.19 x 76.8 x 14.34mm
14. Weight: 257g
15. IP68 / IP69K / MIL-STD-810H Splash, Water and Dust Resistant
Display Screen:
1. Size: 5.45 inch
2. Type: All-screen LCD Multi-Touch display with IPS technology
3. Resolution: 720 x 1440 HD+
Cameras:
1. Rear Camera: 13MP Rear Camera IMX214 sensor FOV 81degree f2.2 large aperture, 5 piece lens
2. Front camera: 8MP OV8856 sensor F2.0, 4 piece lens
3. Rear camera photography features: Normal Mode , Pro Mode, Portrait, Beauty, Time Lapse, Intelligent Scanning, HDR, Location info, Brand watermark, Camera mute, Touch shooting, Self timer, Grid line, Volume key feature, Anti flicker, Filter
4. Front camera photography features: Normal mode, Portrait, Beauty, Location info, Brand watermark, Mirror, Camera mute, Touch shooting, Self timer, Grid line, Volume key feature, Anti flicker, Filter
Network Bands:
1. 4G: FDD-LTE B1/B2/B3/B4/B5/B7/B8/B12/B17/B19/B20/B28A/B28B
2. 3G WCDMA: B1/B2/B4/B5/B8
3. 2G GSM: B2/B3/B5/B8
4. Support 4G VoLTE
Wireless Transmission:
1. Wi-Fi: 802.11 ac/a/b/g/n 2.4GHz & 5GHz
2. BT: V5.0
3. GPS Positioning: GPS, GLONASS, Beidou, Galileo, Support Digital Compass
4. NFC: Yes, Support Google Pay
Languages:
- Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese
Package List:
1. Armor X12 x 1
2. EU AC Power Charger x 1
3. Data Cable x 1
4. Protective Film(Pre-installed) x 1
5. SIM Needle x 1
6. Lanyard x 1
7. Multi-language user manual x 1
8. Multi Function Instruction card x 1
9. Warranty card x 1
10. Charging Instruction card x 1
11. Safety Prompt card x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
2. GPU: Mali-G57 MC2 1.0GHz
3. Memory: 12GB(plus 12GB virtual memory can be extended to 24GB)+256GB
4. Storage Extend: TF card up to 1TB (not included)
5. Operating system: Android 14
6. Sensor: NFC, Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Infrared sensor
7. Sim-card type: Two nano card
8. Charge Port: Type-C
9. Headphone Jack: 3.5mm
10. Battery: 22000mAh lithium-ion polymer battery
11. Charge: 66W fast charging, Support 10W reverse charging
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 181.2 x 87 x 27.5mm
14. Weight: 647g
Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Glass: Corning Gorilla Glass 5
4. Screen resolution: LCD Multi-Touch display with IPS, 1080 x 2460
5. PPI: 396
7. Ratio: 20.5:9
Cameras:
1. Rear Camera: 64MP wide-angle IMX686 sensor FOV 79.8 degree, F1.89 large aperture, 6 piece lens + 64MP night vision camera OV64B sensor FOV 79.8 degree, F1.79 large aperture
2. Front camera: 16MP S5K3P8 sensor F2.2 1/3 inch, 6 piece lens, FOV 76.3 degree
3. Rear camera photography features: Normal mode, Night Vision Mode, Film Mode, 64MP Mode, Night Mode, Gif, Portrait, Pro Mode, panorama, Slow Motion, Time Lapse, Intelligent Scanning, HDR, Filters, AI scene detection, Location info, Brand watermark, Camera mute, Touch shooting, Self timer, Grid line, Volume key feature, Anti flicker, Long Press
4. Front camera photography features: Normal mode, Film, Gif, Portrait, Location info, Brand watermark, Mirror, Camera mute, Touch shooting, Self timer, Grid line, Volume key feature, Anti flicker
Network Bands:
1. 4G: FDD-LTE B1/B2/B3/B4/B5/B7/B8/B12/B17/B19/B20/B28A/B28B/B66; TDD-LTE: B34/B38/B39/B40/B41
2. 3G WCDMA: B1/B2/B4/B5/B8
3. 2G GSM: B2/B3/B5/B8
4. Support 4G VoLTE
Wireless Transmission:
1. Wi-Fi: 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning: GPS, GLONASS, Beidou, Galileo, Support Digital Compass
4. NFC: Yes
Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese
Package List:
1. Armor 24
2. AC Power Charger x 1
3. Data Cable x 1
4. Protective Film(Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. Lanyard x 1
7. SIM Needle x 1
8. Multi-language user manual x 1
9. Multi Function Instruction card x 1
10. Warranty card x 1
11. Charging Instruction card x 1
12. Safety Prompt card x 1
13. Acessories Ecosystem Brochure x 1
| General |
|
| Package Weight |
|
Receives in 7 days.
Hiển thị 450/501
Khám phá Bộ sưu tập Liên quan
Mô tả bộ sưu tập
Khám phá điện thoại thông minh và điện thoại di động mới nhất tại Trustpick. Từ các mẫu flagship đến các lựa chọn tiết kiệm, tìm các thương hiệu hàng đầu với tính năng tiên tiến, hiệu suất nhanh và màn hình tuyệt đẹp. Mua sắm tự tin — giao hàng nhanh trên toàn thế giới có sẵn.
- Chọn một lựa chọn sẽ làm mới toàn bộ trang.
- Mở ra trong cửa sổ mới.