Phụ kiện Điện tử & Thiết bị Thông minh - Trustpick

	__ __
Mô tả	Mô tả - __
Đánh giá	Đánh giá - __
Nhà cung cấp	Nhà cung cấp - __
Màu sắc	Màu sắc - __
	Xem chi tiết đầy đủ

Ulefone Armor 28 Phiên bản UltraThermal Điện thoại bền, 16GB+1TB, Tầm nhìn ban đêm, 10600mAh, 6.67 inch Android 14 MediaTek Dimensity 9300+ Octa Core, Mạng: 5G, NFC, Armor 28 Ultra Phiên bản Thermal

Ulefone

Ulefone Armor 28 Phiên bản UltraThermal Điện thoại bền, 16GB+1TB, Tầm nhìn ban đêm, 10600mAh, 6.67 inch Android 14 MediaTek Dimensity 9300+ Octa Core, Mạng: 5G, NFC, Armor 28 Ultra Phiên bản Thermal

27.431.000 VND 36.801.000 VND

-25%

Specifications
1. CPU: MediaTek Dimensity 9300+, 4nm, octa-core, 1x Arm Cortex-X4 up to 3.4GHz, 3x Arm Cortex-X4 up to 2.85GHz, 4x Arm Cortex-A720 up to 2.0GHz
2. GPU: Immortalis-G720, 1.3GHz
3. Memory: 16GB LPDDR5X + 16GB Dynamic RAM (The Dynamic RAM can be extended in Settings if needed. )+1TB UFS4.0
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 15
6. Sensor: Proximity sensor, gravity sensor, light sensor, acceleration sensor, geomagnetic sensor, gyro sensor, coulomb counter, pedometer, air pressure sensor, infrared sensor
7. Expansion Connector: uSmart Expansion Connector, supporting uSmart series accessories. (not included)
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Right: Power button (Fingerprint) + Volume button + Camera Key, Left: Custom Key
10. Battery: 10600mAh li-ion polymer battery
11. Charge: 120W, 20V/6A, 50W wireless charge, support 10W reverse charging
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 174.15 x 83.6 x 19.4 mm / 6.86 x 3.29 x 0.76 inch
14. Weight: 450g
15. Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor., Burmese, Japanese, Simplified Chinese, Traditional Chinese

Display Screens:
1. Main: 6.67 inch AMOLED, 120Hz, 92%, 1080 x 2400 FHD+, 395PPI, 20:9, 10 point touch
2. Sub: 1.04 inch AMOLED, 60Hz, 340 x 340 HD+, single point touch

Cameras:
1. Rear Camera: 50MP Main (IMX989, 8P lens, FOV 85.1 degrees, F1.9) + 64MP Night Vision (OV64B, F1.79) + 50MP wide (JN1, FOV 117.3 degrees, F2.2)
2. Front camera: 50MP(JN1, 5P lens, FOV 80.4 degree, F2.45)

Network & Connection
Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/32/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR

Wireless Transmission:
1. Wi-Fi: WiFi 7 (2.4GHz/5GHz/6GHz), 802.11 be/ax/ac/a/b/g/n
2. BT: V5.4
3. GPS Positioning: GPS/GLONASS/Beidou/Galileo/QZSS/NavlC GPS
4. OTG: Support
5. NFC: Support
6. FM: Support
7. IR Blaster: Support

Thermal Imaging
1. Thermal Sensor: ThermoVue T2
2. Infrared ISP: Independent Infrared ISP
3. App: ThermoVue Pro
4. Resolution: 640 x 512
5. Frame Rate: 25Hz
6. Pixel Pitch: 12um
7. Thermal Sensitivity (NETD): Less thand 40mk
8. Temperature Measurement: -20 degree C to 550 degree C
9. Accuracy: +/-2 degree C

Package List
1. Phone x 1
2. AC Power Charger x 1
3. Type-C to Type-C Data cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1
15. ThermoVue Pro User Manual Access Guide x 1
16. User Tribute Card x 1

Specification:

General

Certificate

MSDS, RCM

Package Weight

One Package Weight

1.22kgs / 2.69lb

One Package Size

20cm * 12cm * 10cm / 7.87inch * 4.72inch * 3.94inch

Qty per Carton

10

Carton Weight

12.20kgs / 26.90lb

Carton Size

52cm * 25cm * 22cm / 20.47inch * 9.84inch * 8.66inch

Loading Container

20GP: 932 cartons * 10 pcs = 9320 pcs
40HQ: 2164 cartons * 10 pcs = 21640 pcs

Còn hàng

Receives in 7 days.

Ulefone Armor 30 Pro Điện thoại bền, 16GB+512GB, Tầm nhìn ban đêm, Màn hình kép 6.95 inch + 3.4 inch Android 14 MediaTek Dimensity 7300X Octa Core, Mạng: 5G, OTG, NFC, Armor 30 Pro

Ulefone

Ulefone Armor 30 Pro Điện thoại bền, 16GB+512GB, Tầm nhìn ban đêm, Màn hình kép 6.95 inch + 3.4 inch Android 14 MediaTek Dimensity 7300X Octa Core, Mạng: 5G, OTG, NFC, Armor 30 Pro

11.642.000 VND 14.488.000 VND

-20%

Base Specifications
1. CPU Model: MediaTek Dimensity 7300X, 4nm, 8 core, 4 x Arm Cortex-A78 up to 2.5GHz + 4x Arm Cortex-A55
2. RAM: 16GB LPDDR5 + 16GB Dynamic RAM (The Dynamic RAM can be extended in Settings if needed. ) + 512GB UFS3.1 ROM
3. GPU: Arm Mali-G615 MC2 1100MHz
4. Expansion Supported: Up to 2TB (not included)
5. Unlock: Fingerprint ID & Face Unlock
6. System: Android 14
7. Ruggedness: IP68/IP69K/MIL-STD-810H
8. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
9. Battery: 12800mAh Li-polymer battery, support 66W, 11V6A/11V3A charging; Standby Time: 690 Hours, Talk Time: 69 Hours
10. Expansion Connector: uSmart Expansion Connector 2.0, suppors uSmart series accessories, allows simultaneous charging while the uSmart Connector is in use.
11. Material: PC + Aluminium
12. USB: Type-C, USB 2.0
13. Headphone Jack: 3.5mm
14. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
15. Keys: Right: Power button (Fingerprint)+Volume button+Camera Key, Left: Custom Key
16. Size: 181.3 x 84.9 x 21.2 mm / 7.14 x 3.34 x 0.84 inch
17. Weight: 509g

Features Specifications
Screen Display:
1. Front Screen: 6.95 inch, 1080 x 2460 FHD+, 20.5:9, 387ppi, 120Hz Refresh Rate, 85% Screen-to-Body Ratio, 10 point touch
2. Back Screen: 3.4 inch, 412 x 960, 60Hz, 5 point touch

Cameras:
1. Rear Camera: 50MP Main F1.95 + 64MP Night Vision F1.79 + 50MP wide F2.2
Front Camera: 32MP F2.45

Network
1. 5G N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/
26/28A/28B/32/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. VoLTE: Support
5. WiFi: WiFi 6 (2.4/5/6GHz), 802.11a/b/g/n/ac/ax
6. Bluetooth Version: BT5.4
7. Navigation: GPS/GLONASS/Beidou/Galileo/QZSS/NavlC GPS
8. OTG: Support
9. NFC: Support
10. IR Blaster: Support
11. FM Radio: Support, headset-free FM radio

Language:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Korean, Burmese, Japanese, Simplified Chinese, Traditional Chinese

Packing List:
1. Phone x 1
2. AC Power Charger, 66W x 1
3. Type-C to Type-C Data Cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Charging Instruction Card x 1
10. Safety Prompt Card x 1

Specification:

General

Certificate

CE, MSDS, FCC

Package Weight

One Package Weight

1.00kgs / 2.20lb

One Package Size

20cm * 12cm * 7cm / 7.87inch * 4.72inch * 2.76inch

Qty per Carton

20

Carton Weight

18.00kgs / 39.68lb

Carton Size

42cm * 25cm * 37cm / 16.54inch * 9.84inch * 14.57inch

Loading Container

20GP: 686 cartons * 20 pcs = 13720 pcs
40HQ: 1593 cartons * 20 pcs = 31860 pcs

Còn hàng

Receives in 7 days.

Xiaomi POCO X7 Pro 5G Toàn cầu, 12GB+256GB, Cảm biến vân tay trong màn hình, 6.67 inch Xiaomi HyperOS 2 MediaTek Dimensity 8400-Ultra Octa Core, NFC, Mạng: 5G, 12GB+256GB

Xiaomi

Xiaomi POCO X7 Pro 5G Toàn cầu, 12GB+256GB, Cảm biến vân tay trong màn hình, 6.67 inch Xiaomi HyperOS 2 MediaTek Dimensity 8400-Ultra Octa Core, NFC, Mạng: 5G, 12GB+256GB

11.449.000 VND 13.207.000 VND

-13%

Specifications:
1. CPU: Dimensity 8400-Ultra, 4nm, 3.25GHz; GPU: Mali-G720
2. Memory: 12GB RAM LPDDR5X + 256GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS 2
4. Battery capacity: 6000mAh
5. Charging: Type-C, 90W fast charging
6. Headphone Port: Type-C
7. SIM Card: Dual SIM
8. Sensor: Proximity sensor, 360 ambient light sensor, accelerometer, flicker Senor, electronic compass, IR blaster, gyroscope, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor
11. Size: 160.75 x 75.24 x 8.29-8.43mm
12. Weight: 195-198g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian

Screen:
1. Size: 6.67 inch DotDisplay, 89.7%
2. Contrast ratio: 5,000,000:1
3. Resolution: 2712 x 1220
4. Corning Gorilla Glass 7i
5. Refresh Rate: 120Hz

Camera:
1. Rear Camera: 50MP OIS F1.5 + 8MP F2.2
2. Front Camera: 20MP F2.2

Network and Connections:
1. WiFi: 802.11a/b/g/n/ac/ax
2. Network Bands:
A. 2G GSM: B2/3/5/8
B. 3G WCDMA: B1/2/4/5/6/8/19
C. 4G TDD: B38/40/41/42/48; FDD: B1/2/3/4/5/7/8/18/19/20/26/28/66
D. 5G SA: N1/2/3/5/7/8/20/26/28/38/40/41/48/66/77/78; NSA: N1/3/5/7/8/28/38/40/41/77/78
3. Navigation: GPS, Glonass, Galileo, Beidou, NavIC
4. Bluetooth: BT5.4

Package List
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. SIM Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)

Specification:

Package Weight

One Package Weight

0.50kgs / 1.11lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

11.00kgs / 24.25lb

Carton Size

42cm * 25cm * 32cm / 16.54inch * 9.84inch * 12.6inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

OnePlus Ace 5, 12GB+512GB, 6.78 inch ColorOS 15.0 Snapdragon 8 Gen 3 Octa Core, NFC, Mạng: 5G, 12GB+512GB

OnePlus

OnePlus Ace 5, 12GB+512GB, 6.78 inch ColorOS 15.0 Snapdragon 8 Gen 3 Octa Core, NFC, Mạng: 5G, 12GB+512GB

14.085.000 VND 21.272.000 VND

-34%

Specifications:
1. CPU: Qualcomm Snapdragon 8 Gen 3, octa-core, 4nm, frequency up to 3.3Hz
2. GPU: Adreno 750 903MHz
3. RAM: 12GB LPDDR5X, ROM:512GB UFS 4.0
4. Operation System: ColorOS 15.0 based on Android
5. Sensors: Proximity sensor, ambient light sensor, color temperature sensor, electronic compass, acceleration sensor, gyroscope, under-screen optical fingerprint sensor, Hall sensor, infrared remote control
6. Battery: 6415mAh
7. Fast charging: 80W
8. SIM card: Dual, Nano-SIM card
9. Charging & Headphone Interface: Type-C
10. Language: Arabic, Bengali, Burmese, English, French, Filipino, Hindi, Indonesian, Khmer, Malay, Russian, Thai, Vietnamese, Simple Chinese, Traditional Chinese, Nepali, Laotian, Korean, Tibetan, Uyghur
12. Dimensions: 161.72 x 75.77 x 8.02mm
13. Weight: About 206-223g

Display Screen:
1. Type: Flat screen, 450 PPI, 93.9%
2. Size: 6.78 inch
3. Resolution: 2780 x 1264
4. Color: 1.07 billion colors
5. Refresh Rate:1-120Hz

Cameras:
1. Rear camera: 50MP main (6P, f1.8, 24mm, OIS, AF) + 8MP wide (5P, f2.2, 16mm, FOV=112 degree) + 2MP macro (3P, f2.4, 22mm)
2. Front Camera: 16MP(IMX480, f2.4)

Network Band:
1. 5G NR: N1/N3/N5/N8/N28A/N38/N40/N41/N48/N66/N77/N78
2. 4G: LTE FDD: B1/3/4/5/8/18/19/26/28A/66; LTE TDD: B34/38/39/40/41/42/48
3. WCDMA: B1/4/5/6/8/19
4. GSM: 850/900/1800MHz
5. Support VoLTE

1. WLAN: Support Wi-Fi 7 (802.11be), Wi-Fi 6 (802.11ax), Wi-Fi 5 (802.11ac), 802.11a/b/g/n; WLAN 2.4G/5G/5.8G
3. Bluetooth: V5.4
4. NFC: Yes
5. Positioning: Beidou, GPS, GLONASS, Galileo, QZSS, A-GNSS assisted positioning, wireless LAN positioning, cellular network positioning

Package List
1. Phone x 1
2. Eject Pin x 1
3. Protective Case x 1
4. USB Cable x 1
5. US Plug Charger x 1
6. Pre-applied protective film x 1
(The actual object shall prevail)

Specification:

Package Weight

One Package Weight

0.65kgs / 1.43lb

One Package Size

20cm * 12cm * 8cm / 7.87inch * 4.72inch * 3.15inch

Qty per Carton

20

Carton Weight

14.00kgs / 30.86lb

Carton Size

42cm * 25cm * 42cm / 16.54inch * 9.84inch * 16.54inch

Loading Container

20GP: 604 cartons * 20 pcs = 12080 pcs
40HQ: 1403 cartons * 20 pcs = 28060 pcs

Còn hàng

Receives in 7 days.

SOYES XS19 Pro, 3GB+32GB, màn hình 3.8 inch Android 12.0 MTK6762 Quad Core, Mạng: 4G, Dual SIM, GPS, OTG, hỗ trợ Google Play Store, 3GB+32GB

SOYES

SOYES XS19 Pro, 3GB+32GB, màn hình 3.8 inch Android 12.0 MTK6762 Quad Core, Mạng: 4G, Dual SIM, GPS, OTG, hỗ trợ Google Play Store, 3GB+32GB

2.796.000 VND 3.607.000 VND

-22%

Còn hàng

Receives in 7 days.

HOTWAV CYBER 13, điện thoại bền IP68/IP69K, 8GB+128GB, pin 10800mAh, màn hình 6.6 inch Android 14.0 Unisoc T606 Octa Core, Mạng: 4G, NFC, OTG

HOTWAV

HOTWAV CYBER 13, điện thoại bền IP68/IP69K, 8GB+128GB, pin 10800mAh, màn hình 6.6 inch Android 14.0 Unisoc T606 Octa Core, Mạng: 4G, NFC, OTG

4.985.000 VND

Platform:
1. Chipset: UNISOC T606
2. CPU: 2 x A75 1.6G+ 6 x A55 1.6GHz 12nm
3. GPU: G57 1Core 750MHz
4. OS: Android 14.0

Memory:
1. RAM/ROM: 8+128GB
2. T-flash Card: Up to 1TB (not included)

Netwrok:
1. 2G: B2/B3/B5/B8
2. 3G: B1/B2/B4/B5/B8
3. 4G: B38/B40/B41/B1/B2/B3/B4/B5/B7/B8/B12/B17/B18/B19/B20/B25/B26/B28A/B28B/B66

Body
1. SIM: Two SIM / nano
2. Dimensions: 176.8x84.2x16.8mm
3. Weight: 388g
4. Build: Front cover: In mold injection hardware
5. Back cover: Plastic
6. Middle frame decoration: Aluminum alloy
7. Side key: Aluminum alloy

Display:
1. Size: 6.6 inch
2. Type: INCELL
3. Resolution: 720x 1612 HD+
4. Pixel Density : 270PPI
5. Aspect Ratio: 20.5:9
6. Contrast: 1500

Cameras:
1. Front Camera: 16MP S5K3P3SP 1/2 inch f2.2, 80 degree Wide Angle
2. Rear Camera: 64MP OV64B40 1/2 inch f1.8, 80 degree Wide Angle

Battery:
1. Capacity: 10800mAh polymer
2. Standby time: 1500H
3. Talk time: 45H
4. Music Play time: 100H

Others:
1. Features: Fingerprint ID, Face ID, NFC, GPS (GPS+BEIDOU+GLONASS+Galileo), Wi-Fi(2.4+5G, WLAN Hotspot), Bluetooth(V5.1), FM, OTG, G-sensor, Proximity Sensor, Ambient Light Senor, Compass (magnetic), Geomagnetism, Hard Coulometer, Sound Amplifier, Smart Gesture
2. Language: Arabic, Bengali, Bulgarian, Burmese, Dutch, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hindi, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Norwegian, Persian, Portuguese, Polish, Romanian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Swahili, Lithuanian, Slovak, Slovenian, Bosnian

Package List:
1. Phone x 1
2. User Manual x 1
3. USB Cable x 1
4. Warranty Card x 1
5. Protective Film x 1
6. EU Plug 5V 2A Power Adapter x 1
7. Package box x 1

Specification:

General

Certificate

CE, MSDS

Package Weight

One Package Weight

0.69kgs / 1.53lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

16.00kgs / 35.27lb

Carton Size

42cm * 32cm * 25cm / 16.54inch * 12.6inch * 9.84inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

Ulefone Armor Mini 20, tầm nhìn ban đêm, 8GB+256GB, điện thoại bền IP68/IP69K, màn hình 4.7 inch Android 14 MediaTek Dimensity 6300 Octa Core, Mạng: 4G, NFC, OTG, Armor Mini 20

Ulefone

Ulefone Armor Mini 20, tầm nhìn ban đêm, 8GB+256GB, điện thoại bền IP68/IP69K, màn hình 4.7 inch Android 14 MediaTek Dimensity 6300 Octa Core, Mạng: 4G, NFC, OTG, Armor Mini 20

6.786.000 VND 8.204.000 VND

-17%

Specifications
1. CPU: MediaTek Helio G99, octa-core, 2.2GHz, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 950MHz
3. Memory: 8GB LPDDR4X +8GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.2
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 14
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Versatile LED Light: 130 Pieces (102 white light beads, 14 blue light beads, 14 red light beads), support SOS, Warning Light
8. Card Slots: 2, 1x Nano-SIM + 1x Nano-SIM / 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button, Left: Custom Key
10. Battery: 6200mAh Li-ion Sub-zero Solid-State Battery
11. Charge: 33W, 11V3A, support 5W reverse charging
12. Wireless Charge: Support, 15W, Ulefone private protocol
13. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
14. USB: Type-C, USB 2.0
15. Headphone Jack: 3.5mm Headphone Jack
16. Language: Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor., Burmese, Japanese, Simplified Chinese, Traditional Chinese
17. Dimensions: 133.5 x 63.3 x 24.9mm
18. Weight: 301g

Display Screen
1. Size: 4.7 inch
2. Refresh rate: 90Hz
3. Screen-to-Body Ratio: 79%
4. Screen resolution: 720 x 1600
5. PPI: 373
6. Multi-touch: 5
7. Ratio: 20:9

Cameras
1. Rear Camera: 50MP Main (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95) + 64MP Night Vision Camera (OV64B1B, FOV 79.8 degrees, F1.79)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45)
3. Photography features: Rear: Normal mode, Night Vision Mode, Film mode, 50MP mode, Night mode, Document correction, GroupPhoto, AI Emoji, Gif, Portrait, Sports, Pro mode, Panorama, Slow motion, Time lapse, Intelligent scanning; Front: Normal mode, Film mode, GroupPhoto, AI Emoji, Gif, Portrait

Network & Connection
Network Bands:
1. 4G FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/32/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE

Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning: GPS, GLONASS, Beidou, Galileo, QZSS
4. NFC: Yes
5. OTG Function: Yes, support wireless reverse charging
6. FM Radio: Support, headset-free FM radio
7. IR Blaster: Support

Package List
1. Phone x 1
2. EU Plug AC Power Charger, 33W x 1
3. Type-C to Type-C Data Cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1

Specification:

General

Certificate

MSDS, ROHS

Package Weight

One Package Weight

0.70kgs / 1.53lb

One Package Size

23cm * 14cm * 9cm / 9.06inch * 5.51inch * 3.54inch

Qty per Carton

20

Carton Weight

14.20kgs / 31.31lb

Carton Size

44cm * 25cm * 37cm / 17.32inch * 9.84inch * 14.57inch

Loading Container

20GP: 655 cartons * 20 pcs = 13100 pcs
40HQ: 1521 cartons * 20 pcs = 30420 pcs

Còn hàng

Receives in 7 days.

Honor X60, 12GB+512GB, cảm biến vân tay bên cạnh, màn hình 6.8 inch MagicOS 8.0 Dimensity 7025-Ultra Octa Core, Mạng: 5G, OTG, không hỗ trợ Google Play, 12GB+512GB

HONOR

Honor X60, 12GB+512GB, cảm biến vân tay bên cạnh, màn hình 6.8 inch MagicOS 8.0 Dimensity 7025-Ultra Octa Core, Mạng: 5G, OTG, không hỗ trợ Google Play, 12GB+512GB

9.905.000 VND 12.920.000 VND

-23%

1. CPU model: Dimensity 7025-Ultra, octa-core, 2xA78 2.5GHz+6xA55 2.0GHz
2. GPU: BXM-8-256
3. Operating System: MagicOS 8.0 (based on Android 14)
4. User Interface: MagicOS 8.0
5. Storage RAM+ROM: 12GB+512GB
6. SIM Card: Nano card, Dual SIM dual standby
7. Data Charging / Earphones Interface: Type-C
8. Sensors: Accelerometer, proximity light sensor (non-entity, replaced by ultrasound), fingerprint sensor (side), gyroscope, compass, gravity sensor
9. Languages: Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian
10. Dimensions: 165.98 x 75.8 x 7.88 mm
11. Weight: 189g (including battery)

Screen:
1. Screen Size: 6.8 inch
2. Screen Color Gamut: 16.7 million colors
3. Screen Ratio: 20.1:9
4. Screen Type: LTPS LCD
5. Screen Resolution: 2412 x 1080
6. Touch Screen: Multi-touch, up to 10 touch points
7. Screen Refresh Rate: 30/48/50/60/90/120Hz
8. Screen Ratio: 93.6%

Cameras:
1. Rear Camera: 108MP (f1.75)
2. Front Camera: 8MP (f2.0)

Battery:
1. Battery Type: Lithium-ion polymer battery
2. Battery Capacity: 5800mAh
3. Quick Charge: Support 11V/3.2A super fast charging, compatible with 9V/2A, 5V/2A charging

Network:
1. Network frequency:
A. 5G: SA
B. 4G: TDD-LTE, FDD-LTE
C. 3G: WCDMA
D. 2G: GSM
2. WLAN: 802.11 a/b/g/n/ac, 2.4GHz and 5GHz, WLAN hotspot, cellular network positioning, WLAN network positioning
3. BT: BT5.3
4. OTG: Support
5. GPS: Support, Glonass, Beidou, AGPS, Galileo

Package List
1. Phone x 1
2. Eject Pin x 1
3. TPU protective case x 1
4. Type-C USB cable x 1
5. US Plug charger x 1
6. TP protective film (pre-attached) x 1
(Note: subject to the actual product)

Specification:

Package Weight

One Package Weight

0.50kgs / 1.11lb

One Package Size

22cm * 16cm * 6cm / 8.66inch * 6.3inch * 2.36inch

Qty per Carton

20

Carton Weight

11.00kgs / 24.25lb

Carton Size

45cm * 32cm * 32cm / 17.72inch * 12.6inch * 12.6inch

Loading Container

20GP: 578 cartons * 20 pcs = 11560 pcs
40HQ: 1343 cartons * 20 pcs = 26860 pcs

Còn hàng

Receives in 7 days.

Unihertz Tank 3 / 8849, 16GB+512GB, camera 200MP, tầm nhìn ban đêm, pin 23800mAh, màn hình 6.79 inch Android 13 Dimensity 8200 Octa Core, Mạng: 5G, Tank 3 không có máy đo khoảng cách laser

Unihertz

Unihertz Tank 3 / 8849, 16GB+512GB, camera 200MP, tầm nhìn ban đêm, pin 23800mAh, màn hình 6.79 inch Android 13 Dimensity 8200 Octa Core, Mạng: 5G, Tank 3 không có máy đo khoảng cách laser

13.796.000 VND 17.169.000 VND

-20%

1. CPU: MT6896 / Dimensity 8200, 2xARM Cortex-A76 2.2GHz + 6xARM Cortex-A55 2.0GHz
2. GPU: Up to 12 GB of LPDDR4X-4266 SDRAM (2 channels,one 16-bit data bus for each)
3. OS: Android 13
4. Memory: 16GB + 512GB LPDDR4
5. Micro SD: TF card up to 2TB (not included)
6. Battery: Non-Removable 23800mAh Battery
7. SIM Card Type: Dual Nano SIM Card
8. Material: Aluminum alloy + Plastic +TPU
9. Dimensions: 179x86x31mm
10. Weight: 666g (Add the battery)

Screen Display:
1. Display Size: 6.79 inch
2. Type: TFT LCD, TP incell process
3. IC: NT36672C
4. Glass: Youji
5. Multi-Touch: 10 Points, Multi-point
6. Resolution: 2460 x 1080 pixels

Cameras:
1. Rear Camera: 200MP AF + 64MP night vision + 50MP wide Angle
2. Front Camera: 50MP FF

Network Connectivity:
1. 5G NR: N1/N2/N3/N5/N7/N8/N12/N20/N25/N28/N38/N40/N41/N66/N77/N78
2. 4G FDD-LTE: B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B66; TDD-LTE: B34/B38/B39/B40/B41/B42
3. 3G WCDMA: B1/B2/B4/B5/B6/B8/B19
4. 2G GSM850/GSM900/DCS1800/PCS1900MHz
5. Wi-Fi: 802.11 a/b/g/n/ac(2.4GHz/5GHz dual mode), support WI-FI Direct connection, WI-FI Display (the screen is wirelessly transmitted to other devices device), WI-FI hotspot V2.0 WIFI MIMO
6. Bluetooth: Bluetooth 5.3
7. NFC: Yes, support reading and writing mode, card mode
8. Navigation: GPS, GLONASS, BEIDOU, Galileo

Features:
1. Sensors: Fingerprint identification, Range sensor, 3 in 1 AL&PS sensor, Low G Sensor, Gyro Sensor, PE+ Charger, Compass, Wake-up, Wake up from screen off
2. Camping Light: Yes, Added red and blue warning light design (Two camping lights in different areas, which can be lit at the same time or separately, need 4 control circuits)
3. Support Language: Arabic, Dutch, Czech, Croatian, Danish, French, English, Finnish, Filipino, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Persian, Portuguese, Polish, Russian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian

Specification:

General

Certificate

CE, MSDS, FCC, UKCA

Package Weight

One Package Weight

1.36kgs / 3.00lb

One Package Size

22cm * 22cm * 7cm / 8.66inch * 8.66inch * 2.76inch

Qty per Carton

10

Carton Weight

17.50kgs / 38.58lb

Carton Size

45cm * 45cm * 35cm / 17.72inch * 17.72inch * 13.78inch

Loading Container

20GP: 376 cartons * 10 pcs = 3760 pcs
40HQ: 873 cartons * 10 pcs = 8730 pcs

Còn hàng

Receives in 7 days.

Ulefone Armor Mini 20 Pro, 8GB+256GB, điện thoại bền IP68/IP69K, màn hình 4.7 inch Android 14 MediaTek Dimensity 6300 5G Octa Core, Mạng: 5G, NFC, OTG, Armor Mini 20 Pro

Ulefone

Ulefone Armor Mini 20 Pro, 8GB+256GB, điện thoại bền IP68/IP69K, màn hình 4.7 inch Android 14 MediaTek Dimensity 6300 5G Octa Core, Mạng: 5G, NFC, OTG, Armor Mini 20 Pro

8.168.000 VND 9.925.000 VND

-18%

Specifications
1. CPU: MediaTek Dimensity 6300, octa-core, 2.4GHz, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 1.0GHz
3. Memory: 8GB LPDDR4X +8GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.2
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 15
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Versatile LED Light: 130 Pieces (102 white light beads, 14 blue light beads, 14 red light beads), support SOS, Warning Light
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button, Left: Custom Key
10. Battery: 6200mAh Li-ion Sub-zero Solid-State Battery
11. Charge: 33W, 11V3A, Support 5W reverse charging
12. Wireless Charge: Support, 15W, Ulefone private protocol
13. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
14. USB: Type-C, USB 2.0
15. Headphone Jack: 3.5mm Headphone Jack
16. Language: Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor., Burmese, Japanese, Simplified Chinese, Traditional Chinese
17. Dimensions: 133.5 x 63.3 x 24.9mm
18. Weight: 301g

Display Screen
1. Size: 4.7 inch
2. Refresh rate: 90Hz
3. Screen-to-Body Ratio: 79%
4. Screen resolution: 720 x 1600
5. PPI: 373
6. Multi-touch: 5
7. Ratio: 20:9

Cameras
1. Rear Camera: 50MP Main (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95) + 64MP Night Vision (OV64B1B CMOS sensor, FOV 79.4 degrees, F1.79)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45)
3. Photography features: Rear: Normal mode, Film mode, 50MP mode, Night mode, Document correction, GroupPhoto, AI Emoji, Gif, Portrait, Sports, Pro mode, Panorama, Slow motion, Time lapse, Intelligent acanning; Front: Normal mode, Film mode, GroupPhoto, AI Emoji, Gif, Portrait

Network & Connection
Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR

Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning: GPS, GLONASS, Beidou, Galileo, QZSS
4. NFC: Yes
5. OTG Function: Yes, support wireless reverse charging
6. FM Radio: Support, headset-free FM radio
7. IR Blaster: Support

Package List
1. Phone x 1
2. EU Plug AC Power Charger, 33W x 1
3. Type-C to Type-C Data Cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1

Specification:

General

Certificate

MSDS

Package Weight

One Package Weight

0.83kgs / 1.83lb

One Package Size

23cm * 14cm * 9cm / 9.06inch * 5.51inch * 3.54inch

Qty per Carton

20

Carton Weight

14.20kgs / 31.31lb

Carton Size

44cm * 25cm * 37cm / 17.32inch * 9.84inch * 14.57inch

Loading Container

20GP: 655 cartons * 20 pcs = 13100 pcs
40HQ: 1521 cartons * 20 pcs = 30420 pcs

Còn hàng

Receives in 7 days.

Điện thoại bền Ulefone Armor 27, 12GB+256GB, tầm nhìn ban đêm, pin 10600mAh, màn hình 6.78 inch Android 14 MediaTek Helio G99 Octa Core, Mạng: 4G, NFC, OTG, Armor 27

Ulefone

Điện thoại bền Ulefone Armor 27, 12GB+256GB, tầm nhìn ban đêm, pin 10600mAh, màn hình 6.78 inch Android 14 MediaTek Helio G99 Octa Core, Mạng: 4G, NFC, OTG, Armor 27

8.362.000 VND 9.405.000 VND

-11%

Specifications
1. CPU: MediaTek Helio G99, octa-core, 2.2GHz, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 1.0GHz
3. Memory: 12GB LPDDR4X +12GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.2
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 14
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector 2.0: uSmart Expansion Connector 2.0, supporting uSmart series accessories. And the type-C port allows charging while the uSmart Connector working
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button, Left: Custom Key
10. Battery: 10600mAh Li-ion sub-zero solid-state battery
11. Charge: 33W, 11V3A, Support 5W reverse charging
12. Wireless Charge: Support, 30W, 16V 1.5A, Ulefone private protocol
13. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
14. USB: Type-C, USB 2.0
15. Headphone Jack: 3.5mm Headphone Jack
16. Language: Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor., Burmese, Japanese, Simplified Chinese, Traditional Chinese
17. Dimensions: 182.8 x 86.8 x 18.5 mm
18. Weight: 441g

Display Screen
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 85%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9

Cameras
1. Rear Camera: 50MP Main Rear Camera (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95) + 64MP Night Vision Camera (OV64B1B CMOS sensor, FOV 79.4 degrees, F1.79 ) + Ultra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45)
3. Rear camera photography features: Normal mode, Night vision mode, Film mode, 50MP mode, Night mode, Document correction, GroupPhoto, AI Emoji, Gif, Portrait, Sports, Pro mode, Panorama, Slow motion, Time lapse, Intelligent acanning
4. Front camera photography features: Normal mode, Film mode, GroupPhoto, AI Emoji, Gif, Portrait

Network & Connection
Network Bands:
1. 4G FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71
2. 4G TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR

Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning: GPS, GLONASS, Beidou, Galileo, QZSS
4. NFC: Yes
5. OTG Function: Yes, support wireless reverse charging
6. FM Radio: Support, headset-free FM radio
7. IR Blaster: Support

Package List
1. Phone x 1
2. EU Plug AC Power Charger, 33W x 1
3. Type-C to Type-C Data Cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1

Specification:

General

Certificate

CE, MSDS

Package Weight

One Package Weight

1.00kgs / 2.20lb

One Package Size

20cm * 12cm * 9cm / 7.87inch * 4.72inch * 3.54inch

Qty per Carton

10

Carton Weight

11.80kgs / 26.01lb

Carton Size

52cm * 25cm * 22cm / 20.47inch * 9.84inch * 8.66inch

Loading Container

20GP: 932 cartons * 10 pcs = 9320 pcs
40HQ: 2164 cartons * 10 pcs = 21640 pcs

Còn hàng

Receives in 7 days.

Xiaomi Redmi Note 14 Pro+, 16GB+512GB, màn hình 6.67 inch Xiaomi HyperOS Snapdragon 7s Gen 3 Octa Core, NFC, Mạng: 5G, 16GB+512GB

Xiaomi

Xiaomi Redmi Note 14 Pro+, 16GB+512GB, màn hình 6.67 inch Xiaomi HyperOS Snapdragon 7s Gen 3 Octa Core, NFC, Mạng: 5G, 16GB+512GB

Từ 11.915.000 VND 15.291.000 VND

-22%

Specifications
1. CPU: Snapdragon 7s Gen 3 4nm processor, octa core, up to 2.5GHz
2. GPU: Adreno GPU
3. Memory Capacity: 16GB+512GB
4. Operating System: Xiaomi HyperOS
5. Sensors: Ultrasonic distance sensor, 360-degree front and rear dual light sensors, acceleration sensor, electronic compass, gyroscope, infrared remote control, flicker sensor, X-axis linear motor
6. Languages: English, Simple Chinese, Traditional Chinese (more languages can be refreshed and updated)
7. SIM card slot: Dual Nano-SIM card slot
8. Charging Interface: Type-C
9. Battery: 6200mAh non-removable battery
10. Charging Power: 90W wired fast charging
11. Size: 162.53 x 74.67 x 8.66mm
12. Weight: 210.8g

Screen Display:
1. Screen: 6.67 inch, 2712 x 1220
2. Display frame rate: 120Hz
3. Touch sampling rate: 480Hz-2560Hz

Cameras:
1. Rear Camera: 50MP Hunter 800 High Dynamic Range Main Camera (OIS, f1.6) + 50MP telephoto lens (60mm, 2.5X optical zoom, f2.0, 50cm focusing distance) + 8MP (120 FOV, f2.2)
2. Front Camera: 20MP OV20B

Network Band:
1. 5G: N1/N3/N5/N8/N28a/N38/N40/N41/N48/N77/N78
2. 4G: FDD-LTE: B1/B3/B5/B8/B19/B28a; TDD-LTE: B34/B38/B39/B40/B41/B42/B48
3. 3G WCDMA: B1/B5/B6/B8/B19
4. 2G GSM: B3/B5/B8

Wireless Network:
1. WiFi protocols: Wi-Fi 6, Wi-Fi 5, Wi-Fi 4 and 802.11a/b/g; WLAN frequency: 2.4G Wi-Fi, 5G Wi-Fi
2. BT: BT5.4
3. NFC: Support
4. GPS: Beidou: B1I + B1C, GPS: L1, Galileo: E1, GLONASS: G1, QZSS: L1, A-GPS, data network positioning, Wi-Fi network positioning, sensor-assisted positioning

Package List
1. Phone x 1
2. Eject Pin x 1
3. Protective Case x 1
4. USB Cable x 1
5. US Plug Charging Adapter x 1
6. Pre-attached Protective Film x 1
7. Package Box x 1
(The actual product shall prevail)

Specification:

Package Weight

One Package Weight

0.65kgs / 1.44lb

One Package Size

23cm * 17cm * 11cm / 9.06inch * 6.69inch * 4.33inch

Qty per Carton

20

Carton Weight

14.00kgs / 30.86lb

Carton Size

56cm * 47cm * 35cm / 22.05inch * 18.5inch * 13.78inch

Loading Container

20GP: 289 cartons * 20 pcs = 5780 pcs
40HQ: 672 cartons * 20 pcs = 13440 pcs

Còn hàng

Receives in 7 days.

SOYES XS18 Pro Max, 2GB+16GB, Face ID, 4.3 inch Android 8.1 MTK6737A Quad Core, Mạng: 4G, OTG, 2 SIM, XS18 Pro Max

SOYES

SOYES XS18 Pro Max, 2GB+16GB, Face ID, 4.3 inch Android 8.1 MTK6737A Quad Core, Mạng: 4G, OTG, 2 SIM, XS18 Pro Max

2.382.000 VND 3.068.000 VND

-22%

Còn hàng

Receives in 7 days.

SOYES XS16, 2GB+16GB, 3.0 inch Android 10.0 MTK6737 Quad Core, Bluetooth, WiFi, Mạng: 4G, 2 SIM, Hỗ trợ Google Play Store, 2GB+16GB

SOYES

SOYES XS16, 2GB+16GB, 3.0 inch Android 10.0 MTK6737 Quad Core, Bluetooth, WiFi, Mạng: 4G, 2 SIM, Hỗ trợ Google Play Store, 2GB+16GB

1.940.000 VND 2.498.000 VND

-22%

Còn hàng

Receives in 7 days.

Điện thoại bền bỉ Unihertz 8849 Tank 2 Pro với máy chiếu tầm nhìn ban đêm, 12GB+256GB, 6.79 inch Android 14 MTK6789 Octa Core, Mạng: 4G

Unihertz

Điện thoại bền bỉ Unihertz 8849 Tank 2 Pro với máy chiếu tầm nhìn ban đêm, 12GB+256GB, 6.79 inch Android 14 MTK6789 Octa Core, Mạng: 4G

13.024.000 VND 16.530.000 VND

-21%

1. CPU: MT6789, 2xARM Cortex-A76 2.2GHz + 6xARM Cortex-A55 2.0GHz
2. GPU: Up to 12 GB of LPDDR4X-4266 SDRAM (2 channels,one 16-bit data bus for each)
3. OS: Android 14
4. Memory: 12GB+512GB
5. Micro SD: TF card up to 2TB (not included)
6. Battery: 23800mAh Battery
7. SIM Card Type: Dual Nano SIM Card
8. Material: Aluminum alloy + Plastic +TPU
9. Earphone Inport: 3.5mm
10. Dimensions: 179x86x30mm
11. Weight: 688g (Add the battery)

Screen Display:
1. Display Size: 6.79 inch
2. Type: TFT LCD, TP incell process
3. IC: ILI7807S
4. Glass: Youji
5. Multi-Touch: 10 Points, Multi-point
6. Resolution: 2460 x 1080 pixels

Cameras:
1. Rear Camera: 100MP OVA0B40 AF + 64MP night vision + 8MP telephoto lens
2. Front Camera: 32MP S5KGD1SP FF

Network Connectivity:
1. 4G FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66
2. TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM850/GSM900/DCS1800/PCS1900MHz
5. Wi-Fi: 802.11 a/b/g/n/ac/ax(2.4GHz/5GHz dual mode)
6. BT: V5.3
7. NFC: Yes, support reading and writing mode, card mode
8. Navigation: GPS, GLONASS, BEIDOU, Galileo

Features:
1. Sensors: Fingerprint identification, Range sensor, 3 in 1 AL&PS sensor, Low G Sensor, Gyro Sensor, 120W PE+ Charger, Compass, Wake-up, Wake up from screen off
2. Camping Light: Yes, Added red and blue warning light design (Two camping lights in different areas, which can be lit at the same time or separately, need 4 control circuits)
3. Projection Function: DLP, resolution 854x480, 100 lumens
4. Support Language: Arabic, Dutch, Czech, Croatian, Danish, French, English, Finnish, Filipino, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Persian, Portuguese, Polish, Russian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian

Specification:

General

Certificate

CE, MSDS

Package Weight

One Package Weight

1.60kgs / 3.53lb

One Package Size

22cm * 22cm * 7cm / 8.66inch * 8.66inch * 2.76inch

Qty per Carton

20

Carton Weight

24.00kgs / 52.91lb

Carton Size

45cm * 45cm * 35cm / 17.72inch * 17.72inch * 13.78inch

Loading Container

20GP: 376 cartons * 20 pcs = 7520 pcs
40HQ: 873 cartons * 20 pcs = 17460 pcs

Còn hàng

Receives in 7 days.

SOYES XS18 Pro, 2GB+16GB, 3.0 inch Android 9.0 MTK6580 Quad Core, Mạng: 3G, 2 SIM, XS18 Pro

SOYES

SOYES XS18 Pro, 2GB+16GB, 3.0 inch Android 9.0 MTK6580 Quad Core, Mạng: 3G, 2 SIM, XS18 Pro

1.493.000 VND 1.931.000 VND

-23%

Còn hàng

Receives in 7 days.

Xiaomi POCO F6 Global, 12GB+512GB, Cảm biến vân tay trong màn hình, 6.67 inch Xiaomi HyperOS Snapdragon 8s Gen 3 Octa Core 3.0GHz, NFC, Mạng: 5G, 12GB+512GB

Xiaomi

Xiaomi POCO F6 Global, 12GB+512GB, Cảm biến vân tay trong màn hình, 6.67 inch Xiaomi HyperOS Snapdragon 8s Gen 3 Octa Core 3.0GHz, NFC, Mạng: 5G, 12GB+512GB

9.322.000 VND 12.246.000 VND

-24%

1. CPU: Flagship Snapdragon 8s Gen 3 Mobile Platform, Flagship TSMC 4nm process, octa-core processor, up to 3.0GHz; GPU: Adreno GPU
2. Memory: 12GB RAM LPDDR5X+ 512GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 90W turbo charging
6. Headphone Port : Type-C
7. SIM Card: Dual SIM, dual standby
8. Sensor: Proximity sensor, ambient light sensor, accelerometer, electronic compass, IR blaster, Gyroscope, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor, AI Face Unlock
11. Size: 160.5 x 74.4 x 7.8mm
12. Weight: 179g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian

Screen:
1. Size: 6.67 inch
2. Contrast ratio: 5,000,000:1
3. Pixel: 2712 x 1220
4. Pixel Density: 466 PPI
5. Refresh Rate: 120Hz
6. Glass: Corning Gorilla Glass Victus

Camera:
1. Rear Camera: 50MP IMX882 F1.59 + 8MP ultra-wide camera IMX355
2. Front Camera: 20MP OV20B F2.2

Network and connections:
1. WiFi: 802.11a/b/g/n/ac/ax
2. Network Bands:
A. GSM: 850/900/1800/1900MHz
B. WCDMA: B1/2/4/5/6/8/19
C. TDD: B38/40/41/42/48
D. FDD: B1/2/3/4/5/7/8/18/19/20/26/28/66
E. 5G Sub 6G: N1/2/3/5/7/8/20/28/38/40/41/48/66/77/78; 5G NSA: N1/3/5/7/8/20/28/38/40/41/66/77/78(5G connectivity may vary based on region availability and local operator support.)
3. Navigation: GPS: L1, GLONASS: G1, Beidou: B1, Galileo E1, QZSS L1
4. Bluetooth: BT5.4

Package Contents:
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)

Specification:

Package Weight

One Package Weight

0.50kgs / 1.11lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

11.00kgs / 24.25lb

Carton Size

42cm * 25cm * 32cm / 16.54inch * 9.84inch * 12.6inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

Xiaomi POCO F6 Global, 8GB+256GB, Cảm biến vân tay trong màn hình, 6.67 inch Xiaomi HyperOS Snapdragon 8s Gen 3 Octa Core 3.0GHz, NFC, Mạng: 5G, 8GB+256GB

Xiaomi

Xiaomi POCO F6 Global, 8GB+256GB, Cảm biến vân tay trong màn hình, 6.67 inch Xiaomi HyperOS Snapdragon 8s Gen 3 Octa Core 3.0GHz, NFC, Mạng: 5G, 8GB+256GB

8.591.000 VND 11.286.000 VND

-24%

1. CPU: Flagship Snapdragon 8s Gen 3 Mobile Platform, Flagship TSMC 4nm process, octa-core processor, up to 3.0GHz; GPU: Adreno GPU
2. Memory: 8GB RAM LPDDR5X+ 256GB ROM UFS 4.0
3. Operating System: Xiaomi HyperOS
4. Battery capacity: 5000mAh
5. Charging: Type-C, 90W turbo charging
6. Headphone Port : Type-C
7. SIM Card: Dual SIM, dual standby
8. Sensor: Proximity sensor, ambient light sensor, accelerometer, electronic compass, IR blaster, Gyroscope, X-axis linear vibration motor
9. NFC: Support
10. Security: In-screen fingerprint sensor, AI Face Unlock
11. Size: 160.5 x 74.4 x 7.8mm
12. Weight: 179g
13. Languages: Arabic, Afrikaans, Amharic, Bengali, Bulgarian, Burmese, Catalan, Dutch, Croatian, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hungarian, Hindi, Hebrew, Indonesian, Italian, Japanese, Khmer, Latvian, Malay, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Simple Chinese, Traditional Chinese, Urdu, Estonian, Lithuanian, Slovak, Slovenian, Bosnian

Screen:
1. Size: 6.67 inch
2. Contrast ratio: 5,000,000:1
3. Pixel: 2712 x 1220
4. Pixel Density: 466 PPI
5. Refresh Rate: 120Hz
6. Glass: Corning Gorilla Glass Victus

Camera:
1. Rear Camera: 50MP IMX882 F1.59 + 8MP ultra-wide camera IMX355
2. Front Camera: 20MP OV20B F2.2
3. Features: Front: Portrait, Beauty; Rear: HDR, Panorama Mode, Portrait, Monochrome Mode, Depth, Beauty, AI

Network and connections:
1. WiFi: 802.11a/b/g/n/ac/ax
2. Network Bands:
A. GSM: 850/900/1800/1900MHz
B. WCDMA: B1/2/4/5/6/8/19
C. TDD: B38/40/41/42/48
D. FDD: B1/2/3/4/5/7/8/18/19/20/26/28/66
E. 5G Sub 6G: N1/2/3/5/7/8/20/28/38/40/41/48/66/77/78; 5G NSA: N1/3/5/7/8/20/28/38/40/41/66/77/78(5G connectivity may vary based on region availability and local operator support.)
3. Navigation: GPS: L1, GLONASS: G1, Beidou: B1, Galileo E1, QZSS L1
4. Bluetooth: BT5.4

Package Contents:
1. Phone x 1
2. Power Adapter x 1
3. USB Type-C Cable x 1
4. Ejector Tool x 1
5. Protective Case x 1
6. User Manual x 1
7. Warranty Card x 1
(Contents in the package may differ across different regions.)

Specification:

Package Weight

One Package Weight

0.55kgs / 1.21lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

11.00kgs / 24.25lb

Carton Size

42cm * 25cm * 32cm / 16.54inch * 9.84inch * 12.6inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

Điện thoại bền bỉ Ulefone Armor 27 Pro, 12GB+256GB, Tầm nhìn ban đêm, 10600mAh, 6.78 inch Android 14 MediaTek Dimensity 6300 Octa Core, Mạng: 5G, NFC, Armor 27 Pro

Ulefone

Điện thoại bền bỉ Ulefone Armor 27 Pro, 12GB+256GB, Tầm nhìn ban đêm, 10600mAh, 6.78 inch Android 14 MediaTek Dimensity 6300 Octa Core, Mạng: 5G, NFC, Armor 27 Pro

9.905.000 VND 11.326.000 VND

-13%

Specifications
1. CPU: MediaTek Dimensity 6300, octa-core, 2.4GHz, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 1.0GHz
3. Memory: 12GB LPDDR4X +12GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.2
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 14
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector 2.0: uSmart Expansion Connector, supporting uSmart series accessories. And the type-C port allows charging while the uSmart Connector working.
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button + SOS Key, Left: Custom Key
10. Battery: 10600mAh Li-ion sub-zero solid-state battery
11. Charge: 33W, 20V/6A, Support 5W reverse charging
12. Wireless Charge: Support, 30W, 16V1.5A, Ulefone private protocol
13. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
14. Digital Toolbox: Height Meter, Compass, Gradienter, Flashlight, Hanging Painting, Magnifier, Alarm bell, Plumb bob, Protractor, Noise Test, Pedometer, Barometer, Funny Sound, Underwater Camera
15. Pre-installed APP: Google Assistant, Calculator, Google Calendar, Camera, Children Space, Chrome, Cleaning Assisitant, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Freezer, Gallery, Game Mode, Gmail, Google, Google TV, Keep Notes, Google Maps, Google Meet, Google Messages, Mobile Guardian, MyFLIR, NFC Access Card, Outdoor Toolkit, Phone, Google Photos, Google Play Store, Remote Control, Safety, Service Center, Settings, SIM ToolKit, Sound Recorder, Theme, Widget Box, YouTube, YT Music
16. Language: Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Korean, Burmese, Japanese, Simplified Chinese, Traditional Chinese
17. Dimensions: 182.8 x 86.8 x 18.5 mm
18. Weight: 441g

Display Screen
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 85%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9

Camera
1. Rear Camera: 50MP Main Rear Camera (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95 large aperture) + 64MP Night Vision Camera (OV64B1B CMOS sensor, FOV 79.4 degrees, F1.79 large aperture) + Ultra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 large aperture)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45 large aperture)
3. Rear camera photography features: Normal mode, Night vision mode, Film mode, 50MP mode, Night mode, Document correction, GroupPhoto, AI Emoji, Gif, Portrait, Sports, Pro mode, Panorama, Slow motion, Time lapse, Intelligent acanning
4. Front camera photography features: Normal mode, Film mode, GroupPhoto, AI Emoji, Gif, Portrait

Network & Connection
Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR

Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning: GPS/GLONASS/Beidou/Galileo/QZSS
4. NFC: Yes
5. OTG Function: Support, reverse charging
6. FM Radio: Support, headset-free FM radio
7. IR Blaster: Support

Package List
1. Phone x 1
2. AC Power Charger, 33W x 1
3. Type-C to Type-C Data Cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1

Specification:

General

Certificate

MSDS, ROHS, RCM

Package Weight

One Package Weight

1.17kgs / 2.58lb

One Package Size

20cm * 12cm * 10cm / 7.87inch * 4.72inch * 3.94inch

Qty per Carton

10

Carton Weight

12.20kgs / 26.90lb

Carton Size

52cm * 25cm * 22cm / 20.47inch * 9.84inch * 8.66inch

Loading Container

20GP: 932 cartons * 10 pcs = 9320 pcs
40HQ: 2164 cartons * 10 pcs = 21640 pcs

Còn hàng

Receives in 7 days.

Điện thoại bền bỉ Ulefone Armor 25T, 6GB+256GB, Hình ảnh nhiệt, 6.78 inch Android 14 MediaTek Helio G99 Octa Core, Mạng: 4G, NFC, OTG, Armor 25T

Ulefone

Điện thoại bền bỉ Ulefone Armor 25T, 6GB+256GB, Hình ảnh nhiệt, 6.78 inch Android 14 MediaTek Helio G99 Octa Core, Mạng: 4G, NFC, OTG, Armor 25T

8.168.000 VND 10.166.000 VND

-20%

Specifications
1. CPU: MediaTek Helio G99 2.2GHz, octa-core, 2 x Arm Cortex-A76, 6 x Arm Cortex-A55
2. GPU: Arm Mali-G57 MC2 1.0GH
3. Memory: 6GB LPDDR4X +6GB virtual RAM (The virtual RAM can be activated in Settings at your will. )+256GB UFS2.1
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 14
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Thermal Sensor, Infrared sensor
7. Digital Toolbox: Compass, SoundMeter, Pic Hanging, Gradienter, HeightMeasure, Magnifier, Protractor, Plumb bob, Alarm bell, Pedometer, Barometer, FunnySound, Torch, Mirror
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Battery: 6500mAh li-ion polymer battery
10. Charge: 33W, 11V3A, Support 5W reverse charging
11. Wireless Charge: Support, 30W, 16V1.5A, Ulefone private protocol
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 177.4 x 81.4 x 12.5 mm
14. Weight: 326g

Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 86%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9

Cameras:
1. Rear Camera: 50MP Main Rear Camera (GN1 CMOS sensor, 1.2um, 7 piece lens, FOV 85 degrees, F1.95 large aperture) + 64MP Night Vision Camera (OV64B1B CMOS sensor, FOV 79.4 degrees, F1.79 large aperture)
2. Front camera: 32MP(GD1 CMOS sensor, 0.8um, 5 piece lens, FOV 80.4 degree, F2.45 large aperture)
3. Rear camera photography features: Normal mode, Night Vision Mode, Night Mode, Beauty Mode, 50MP Mode, Pro Mode, Portrait, Gif, Panorama, Slow Motion, Mono, Bokeh, QR Code
4. Front camera photography features: Normal mode, Beauty Mode, Portrait, Gif, Mono

Network Bands:
1.4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support VoLTE

Wireless Transmission:
1. Wi-Fi: 2.4G/5G, 802.11 a/ac/b/g/n
2. BT: V5.2
3. GPS Positioning:GPS/GLONASS/Beidou/Galileo/QZSS
4. NFC: Support
5. OTG Function: Support

Thermal Imaging
1. App: ThermoVue
2. Resolution: 160 x 120
3. Refresh Rate: 25Hz
4. Pixel Pitch: 12um
5. NETD: Less than 50mK at 25 degree C, F#1.0, 25Hz
6. Temperature Measurement: -20 degree C to 550 degree C
7. Accuracy: 3 degree C

Other Specifications
Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese

Pre-installed APP:
Google Assistant, Calculator, Google Calendar, Camera, Child mode, Chrome, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Game Mode, Gmail, Google, Google Maps, Google Meet, Google Messages, Phone, Google Photos, Google Play Store, QRCode Scan, Remote Control, Safety, Service Center, Settings, SIM ToolKit, Sound Recorder, System Manager, ThermoVue, Toolbag, Youtube, YT Music

Package List
1. Phone x 1
2. AC Power Charger 33W x 1
3. Type-C to Type-C Data cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x 1
15. Thermal Imaging User Manual Access Guide x 1

Specification:

General

Certificate

MSDS

Package Weight

One Package Weight

1.25kgs / 2.76lb

One Package Size

20cm * 12cm * 10cm / 7.87inch * 4.72inch * 3.94inch

Qty per Carton

10

Carton Weight

12.20kgs / 26.90lb

Carton Size

52cm * 25cm * 22cm / 20.47inch * 9.84inch * 8.66inch

Loading Container

20GP: 932 cartons * 10 pcs = 9320 pcs
40HQ: 2164 cartons * 10 pcs = 21640 pcs

Còn hàng

Receives in 7 days.

Điện thoại bền bỉ HOTWAV Cyber 15, IP68/IP69K, 6280mAh, 6.6 inch Android 13 MediaTek MT6789 Helio G99 Octa Core, Mạng: 4G, NFC, OTG, 12GB+256GB

HOTWAV

Điện thoại bền bỉ HOTWAV Cyber 15, IP68/IP69K, 6280mAh, 6.6 inch Android 13 MediaTek MT6789 Helio G99 Octa Core, Mạng: 4G, NFC, OTG, 12GB+256GB

5.918.000 VND 7.364.000 VND

-20%

Platform:
1. Chipset: MT 6789 Helio G99, 6nm
2. CPU: 2x A76 2.0GHz +6x A55 2.0GHz
3. GPU: Arm Mali-G57 MC2
4. OS: Android 13.0

Memory:
1. RAM/ROM: 12+256GB
2. T-flash Card: Up to 2TB (not included)

Netwrok:
1. 2G: B2/B3/B5/B8
2. 3G: B1/B2/B4/B5/B8
3. 4G: B34/B38/B39/B40/B41/B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B30/B66/B71

Body:
1. SIM: Two SIM / nano
2. Dimensions: 174.6x82.3x12.8mm
3. Weight: 290g
4. Build: Front cover: In mold injection hardware
5. Back cover: Plastic
6. Middle frame decoration: Aluminum alloy
7. Side key: Aluminum alloy

Display:
1. Size: 6.6 inch, 1.45 inch
2. Type: INCELL, G+F
3. Resolution: 1080x 2408 FHD+, 240 x 240
4. Refresh Rate: 120Hz
5. Aspect Ratio: 20.5:9; 18:9
6. Contrast: 1500

Cameras:
1. Front Camera: 32MP IMX616 1/2.7 inch f2.45, 80 degree Wide Angle
2. Rear Camera: 200MP S5KHP3SP 1/1.4 inch f1.8, 80 degree Wide Angle
3. Rear Night Vision Camera: 24MP OV24A1B 1/2.8 inch f1.8, 80 degree Wide Angle

Battery:
1. Capacity: 6280mAh polymer
2. Standby time: 1500H
3. Talk time: 45H
4. Music Play time: 100H
5. Charger: 33W

Others:
1. Features: Fingerprint ID, Face ID, NFC, GPS (GPS+BEIDOU+GLONASS+Galileo), Wi-Fi(2.4+5G, WLAN Hotspot), Bluetooth(V5.1), FM, OTG, G-sensor, Proximity Sensor, Ambient Light Senor, Compass (magnetic), Geomagnetism, Gyroscope,Hard Coulometer, Rapid Charge, Sound Amplifier, Smart Gesture, Air Gesture,
2. Language: Arabic, Bengali, Bulgarian, Burmese, Dutch, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hindi, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Norwegian, Persian, Portuguese, Polish, Romanian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Swahili, Lithuanian, Slovak, Slovenian, Bosnian

Package List:
1. Phone x 1
2. User Manual x 1
3. USB Cable x 1
4. Warranty Card x 1
5. OTG Cable x 1
6. EU Plug Power Adapter x 1
7. Color protective film x 1

Specification:

General

Certificate

ROHS

Package Weight

One Package Weight

0.65kgs / 1.44lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

16.00kgs / 35.27lb

Carton Size

42cm * 32cm * 25cm / 16.54inch * 12.6inch * 9.84inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

Ulefone Armor 26 Ultra Điện thoại bền bỉ, Màn hình 6.78 inch Android 13 MediaTek Dimensity 8020 Octa Core, Mạng: 5G, NFC, 12GB+512GB

Ulefone

Ulefone Armor 26 Ultra Điện thoại bền bỉ, Màn hình 6.78 inch Android 13 MediaTek Dimensity 8020 Octa Core, Mạng: 5G, NFC, 12GB+512GB

12.510.000 VND 15.568.000 VND

-20%

1. CPU: MediaTek Dimensity 8020, octa-core, 4 x Arm Cortex-A78, 4 x Arm Cortex-A55
2. GPU: Mali-G57 MC2 1.0GHz
3. Memory: 12GB(plus 12GB virtual memory can be extended to 24GB)+512GB
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector: uSmart Expansion Connector, supporting uSmart series accessories.
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button + SOS Key，Left: Custom Key
10. Battery: 15600mAh li-ion polymer battery
11. Charge: 120W, 20V/6A, Support 10W reverse charging
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 179 x 83 x 25.5 mm
14. Weight: 600g

Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 84%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9

Cameras:
1. Rear Camera: 200MP Main Rear Camera (HP3 CMOS sensor, 0.56um, 7 piece lens, FOV 84.7 degrees, F1.79 large aperture) +
64MP Night Vision Camera (OV64B1B CMOS sensor, F1.79 large aperture) + 50MPUltra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 large aperture) 8MP 3.2X Optical Zoom Telephoto Lens (Hi847 CMOS sensor, 3.2X Optical Zoom, 30x Digital Zoom, Supports Zoom EIS)
2. Front camera: 50MP(Hi5022Q CMOS sensor, 1.0um, 5 piece lens, FOV 80.4 degree, F2.25 large aperture)
3. Rear camera photography features: Normal mode, Night Vision Mode, Film Mode, 200MP Mode, Night Mode, Gif, Portrait, Pro Mode, Panorama, Slow Motion, Time Lapse, Macro, Intelligent Scanning
4. Front camera photography features: Normal mode, Film, Gif, Portrait

Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR

Wireless Transmission:
1. Wi-Fi: 2.4G/5G/WiFi 6, 802.11 ax/ac/a/b/g/n
2. BT: V5.1
3. GPS Positioning: (L1+L5) GPS/GLONASS/Beidou/Galileo/QZSSCompass
4. NFC: Yes
5. OTG Function: Support, max 27W (9V3A) reverse charging

Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese

Pre-installed APP:
Google Assistant, Calculator, Google Calendar, Camera, Children Space, Chrome, Cleaning Assistant, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Funny Sound, Game Booster, Gmail, Google, Google TV, Lenscase, Google Maps, Google Meet, Google Messages, Mobile Guardian, Outdoor Toolbox, Phone, Google Photos, Google Play Store, PrizeInterPhone, Remote Control, Safety, Service Center, Settings, SIM Toolkit, Sound Recorder, Theme, Widget Box, Youtube, YT Music

Package List:
1. Phone x 1
2. AC Power Charger x 1
3. Type-C to Type-C Data cable (100cm) x 1
4. Protective Film (Pre-installed) x 1
5. Tempered Glass Screen Protector x 1
6. SIM Needle x 1
7. Lanyard x 1
8. Multi-language User Manual x 1
9. Multi Function Instruction Card x 1
10. Warranty Card x 1
11. Charging Instruction Card x 1
12. Safety Prompt Card x 1
13. Accessories Ecosystem Brochure x 1
14. Service Center APP Instructions x

Specification:

General

Certificate

CE, MSDS

Package Weight

One Package Weight

1.40kgs / 3.09lb

One Package Size

20cm * 12cm * 10cm / 7.87inch * 4.72inch * 3.94inch

Qty per Carton

10

Carton Weight

12.20kgs / 26.90lb

Carton Size

52cm * 25cm * 22cm / 20.47inch * 9.84inch * 8.66inch

Loading Container

20GP: 932 cartons * 10 pcs = 9320 pcs
40HQ: 2164 cartons * 10 pcs = 21640 pcs

Còn hàng

Receives in 7 days.

Ulefone Armor 26 Ultra Phiên bản bộ đàm Điện thoại bền bỉ, Màn hình 6.78 inch Android 13 MediaTek Dimensity 8020 Octa Core, Mạng: 5G, NFC, 12GB+512GB Phiên bản bộ đàm

Ulefone

Ulefone Armor 26 Ultra Phiên bản bộ đàm Điện thoại bền bỉ, Màn hình 6.78 inch Android 13 MediaTek Dimensity 8020 Octa Core, Mạng: 5G, NFC, 12GB+512GB Phiên bản bộ đàm

14.504.000 VND 18.049.000 VND

-20%

1. CPU: MediaTek Dimensity 8020, octa-core, 4 x Arm Cortex-A78, 4 x Arm Cortex-A55
2. GPU: Mali-G57 MC2 1.0GHz
3. Memory: 12GB(plus 12GB virtual memory can be extended to 24GB)+512GB
4. Storage Extend: TF card up to 2TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Gravity sensor, Light Sensor, Acceleration Sensor, Geomagnetic sensor, Gyro sensor, Coulomb counter, Pedometer, Air pressure sensor, Infrared sensor
7. Expansion Connector: uSmart Expansion Connector, supporting uSmart series accessories.
8. Card Slots: 3, 1x Nano-SIM + 1x Nano-SIM + 1x microSD
9. Keys: Right: Power button(Fingerprint)+Volume button + SOS Key，Left: Custom Key(default PTT Key)
10. Battery: 15600mAh li-ion polymer battery
11. Charge: 120W, 20V/6A, Support 10W reverse charging
12. Unlock Options: Side-Mounted Fingerprint Unlock, Face Unlock
13. Dimensions: 179 x 83 x 25.5 mm
14. Weight: 600g

Display Screen:
1. Size: 6.78 inch
2. Refresh rate: 120Hz
3. Screen-to-Body Ratio: 84%
4. Screen resolution: 1080 x 2460
5. PPI: 396
6. Multi-touch: 10
7. Ratio: 20.5:9

Cameras:
1. Rear Camera: 200MP Main Rear Camera (HP3 CMOS sensor, 0.56um, 7 piece lens, FOV 84.7 degrees, F1.79 large aperture) + 64MP Night Vision Camera (OV64B1B CMOS sensor, F1.79 large aperture) + 50MPUltra-wide Angle Lens (Hi5022Q CMOS sensor, FOV 117.3 degrees, F2.2 large aperture) 8MP 3.2X Optical Zoom Telephoto Lens (Hi847 CMOS sensor, 3.2X Optical Zoom, 30x Digital Zoom, Supports Zoom EIS)
2. Front camera: 50MP(Hi5022Q CMOS sensor, 1.0um, 5 piece lens, FOV 80.4 degree, F2.25 large aperture)
3. Rear camera photography features: Normal mode, Night Vision Mode, Film Mode, 200MP Mode, Night Mode, Gif, Portrait, Pro Mode, Panorama, Slow Motion, Time Lapse, Macro, Intelligent Scanning
4. Front camera photography features: Normal mode, Film, Gif, Portrait

Network Bands:
1. 5G NR Sub6: N1/2/3/5/7/8/20/25/28/38/40/41/66/71/77/78/79
2. 4G: FDD-LTE: B1/2/3/4/5/7/8/12/13/17/18/19/20/25/26/28A/28B/66/71; TDD-LTE: B34/38/39/40/41
3. 3G WCDMA: B1/2/4/5/6/8/19
4. 2G GSM: B2/3/5/8
5. Support 4G VoLTE, VoNR

Wireless Transmission:
1. Wi-Fi: 2.4G/5G/WiFi 6, 802.11 ax/ac/a/b/g/n
2. BT: V5.1
3. GPS Positioning: (L1+L5) GPS/GLONASS/Beidou/Galileo/QZSS Compass
4. NFC: Yes
5. OTG Function: Support, max 27W (9V3A) reverse charging

Radio Communication:
1. Type: Dual-mode (digital/analog) dual-band (UHF/VHF), dual-slot, support DMR
2. Frequency Range: UHF Band: 400MHz-470MHz; VHF Band: 137MHz-172MHz
3. Operating Range: UHF Band: 0-22KM; VHF Band: 0-30KM
4. App: PrizeInterPhone
5. Shortcut Key: PTT Key (One-key to talk)

Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Kor, Burmese, Japanese, Simplified Chinese, Traditional Chinese

Pre-installed APP:
Google Assistant, Calculator, Google Calendar, Camera, Children Space, Chrome, Cleaning Assistant, Clock, Contacts, Google Drive, Easy Launcher, Files by Google, Find Device, FM Radio, Funny Sound, Game Booster, Gmail, Google, Google TV, Lenscase, Google Maps, Google Meet, Google Messages, Mobile Guardian, Outdoor Toolbox, Phone, Google Photos, Google Play Store, PrizeInterPhone, Remote Control, Safety, Service Center, Settings, SIM Toolkit, Sound Recorder, Theme, Widget Box, Youtube, YT Music

Package List:
1. Phone x 1
2. Detachable Antenna (UHF+VHF ) x 2
3. AC Power Charger x 1
4. Type-C to Type-C Data cable (100cm) x 1
5. Protective Film (Pre-installed) x 1
6. Tempered Glass Screen Protector x 1
7. SIM Needle x 1
8. Lanyard x 1
9. Multi-language User Manual x 1
10. Multi Function Instruction Card x 1
11. Walkie-Talkie User Guides x 1
12. Warranty Card x 1
13. Charging Instruction Card x 1
14. Safety Prompt Card x 1
15. Accessories Ecosystem Brochure x 1
16. Service Center APP Instructions x 1

Specification:

General

Certificate

CE, MSDS

Package Weight

One Package Weight

1.50kgs / 3.31lb

One Package Size

20cm * 12cm * 10cm / 7.87inch * 4.72inch * 3.94inch

Qty per Carton

10

Carton Weight

12.50kgs / 27.56lb

Carton Size

52cm * 25cm * 22cm / 20.47inch * 9.84inch * 8.66inch

Loading Container

20GP: 932 cartons * 10 pcs = 9320 pcs
40HQ: 2164 cartons * 10 pcs = 21640 pcs

Còn hàng

Receives in 7 days.

HOTWAV Note 13, Nhận diện vân tay bên cạnh, Màn hình 6.6 inch Android 13 T606 Octa Core lên đến 1.6GHz, Mạng: 4G, OTG, 4GB+128GB

HOTWAV

HOTWAV Note 13, Nhận diện vân tay bên cạnh, Màn hình 6.6 inch Android 13 T606 Octa Core lên đến 1.6GHz, Mạng: 4G, OTG, 4GB+128GB

2.620.000 VND 2.918.000 VND

-10%

1. CPU: T606, octa-core, 12nm, 6 x Arm Cortex-A55 + 2 x Arm Cortex-A75 1.6GHz
2. GPU: G57 650MHz
3. Memory: 4GB+128GB
4. Storage Extend: TF card up to 1TB (not included)
5. Operating system: Android 13
6. Sensor: Proximity Sensor, Light Sensor, G-Sensor, side-mounted fingerprint
7. Sim-card type: Two nano card
8. Charge Port: Type-C
9. Dimensions: 166.2 x 76.5 x 8.7mm
10. Weight: 235g

Display Screen:
1. Size: 6.6 inch
2. Screen to Body Ratio: 91.5%
3. Multi-touch: 10 points
4. Screen resolution: 1612 x 720
5. Aspect Ratio: 20:09
6. PPI: 273
7. Glass: Panda
8. Refresh Rate: 90Hz

Cameras:
1. Rear Camera: 50MP OV50C40 1/2.5 inch F1.8, 78.83 degree FOV + 0.08MP GC6133
2. Front camera: 16MP S5K3P3 1/3.1 inch F2.2

Network Bands:
1. 4G: FDD-LTE B1/B3/B5/B7/B8/B20/B28AB/B66
2. 3G: WCDMA B1/B2/B5/B8
3. 2G: GSM B2/B3/B5/B8

Battery:
1. Battery Capacity: 5160mAh
2. Standby Time: 1000 hours
3. Talk Time: 4 hours
4. Music Play Time: 60 hours
5. Charger Power: 10W

Wireless Transmission:
1. Wi-Fi: 802.11a/b/g/n, 2.4GHz/5.0GHz
2. BT: BT5.0
3. GPS Positioning: Beidou, Galileo, Glonass, GPS
4. OTG: Yes

Languages:
Arabic, Afrikaans, Bengali, Burmese, Czech, Catalan, Dutch, Danish, English, French, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Khmer, Norwegian, Persian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Urdu, Armenian, Zulu, Swahili, Slovak, Slovenian

Package List:
1. Phone x 1
2. Screen Protector (pre-applied) x 1
3. Type-C Cable x 1
4. Power Adapter x 1
5. Quick Start Guide x 1
6. OTG Cable x 1
7. Phone Case x 1
(Note: Subject to actual product)

Specification:

Package Weight

One Package Weight

0.55kgs / 1.22lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

11.60kgs / 25.57lb

Carton Size

42cm * 25cm * 32cm / 16.54inch * 9.84inch * 12.6inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

HUAWEI Pura 70 Ultra, Nhận diện vân tay trên màn hình, Màn hình 6.8 inch HarmonyOS 4.2 Kirin 9010 Octa Core lên đến 2.3GHz, NFC, OTG, Không hỗ trợ Google Play, 16GB+512GB, 16GB+1TB

Huawei

HUAWEI Pura 70 Ultra, Nhận diện vân tay trên màn hình, Màn hình 6.8 inch HarmonyOS 4.2 Kirin 9010 Octa Core lên đến 2.3GHz, NFC, OTG, Không hỗ trợ Google Play, 16GB+512GB, 16GB+1TB

Từ 42.031.000 VND 53.940.000 VND

-22%

1. Model: HBP-AL00
2. Operating system: HarmonyOS 4.2
3. CPU: Kirin 9010 7 nm, Octa-core (1x2.3 GHz Taishan Big & 3x2.18 GHz Taishan Mid & 4x1.55 GHz Cortex-A510)
4. Storage RAM+ROM: 16GB+512GB / 16GB+1TB (optional)
5. Dual SIM: Dual SIM, dual standby
6. SIM card type: Card slot 1: Nano SIM card Card slot 2: Nano SIM card
7. Data cable interface: Type-C, USB 3.1 GEN1
8. Headphone interface: Type-C
9. Waterproof and dustproof: IP68 Waterproof for daily life
10. Sensors: Ambient light sensor, infrared sensor, fingerprint sensor (in-screen fingerprint), Hall sensor, gyroscope, compass, NFC, proximity light sensor, gravity sensor, attitude sensor, Camera laser focus sensor, multispectral sensor
11. Body size: 162.6 x 75.1 x 8.4mm
12. Body weight: about 226g (including battery)

Screen:
1. Screen size: 6.8 inch
2. Screen color gamut: 1.07 billion colors, P3 wide color gamut
3. Glass material: Basalt Tempered Kunlun Glass
4. Screen type: OLED, support 1-120Hz LTPO adaptive refresh rate, 1440Hz high-frequency PWM dimming, 300Hz touch sampling rate
5. Screen resolution: FHD+ 2844 × 1260 pixels
6. Touch screen: Multi-touch, 10 points touch

Camera:
1. Dual rear cameras: 50MP super-concentrating retractable camera (1 inch, F1.6~F4.0 aperture, sensor shift anti-shake) + 40MP ultra-wide-angle camera (F2.2 aperture) + 50MP super-concentrating macro telephoto camera (F2.1 aperture) , OIS optical image stabilization), support autofocus
2. Front camera: 13MP ultra-wide-angle camera (F2.4 aperture, AF)
3. Rear camera: Wind speed flash, high-definition mode, intelligent variable aperture, adjustable physical aperture, super night scene, super macro, macro video, video HDR Vivid, macro picture-in-picture, telephoto picture-in-picture, microfilm, audio zoom, high-pixel mode, delay photography, ultra-wide angle, large aperture blur, dual-scene recording, portrait mode, professional mode, slow motion, panorama mode, flowing light shutter, intelligent filter, multi-camera setup, watermark, document correction, AI photography master, dynamic photos, 4D predictive autofocus, smile capture, voice control photography, timed photography, burst mode.Front camera: Video HDR Vivid, slow motion, eye tracking autofocus, intelligent wide-angle switching, portrait mode, panorama mode, delay photography, dynamic photos, intelligent filters, watermark, smile capture, selfie mirror, voice control photography, timed photography.
(Note: Video pixels in different shooting modes may be different, please refer to the actual situation.)

Battery:
1. Battery type: Lithium-ion polymer battery
2. Battery capacity: 5200mAh (typical value)
3. Charger: USB-A port: Support 5V2A or 10V4A or 11V6A Max or 20V5A Max output; USB-C port: Support 5V3A or 9V3A or 10V4A or 11V6A Max or 12V3A or 15V3A Max or 20V5A Max output
4. Theoretical charging time: About 0.6 hours
5. Fast charging function: Wired charging: 100W, 18W reverse charging. Wireless charging: 80W, 20W wireless reverse charging.
6. Wireless charging: Support 50W Huawei wireless super fast charging, 20W wireless reverse charging.

Data Connections:
1. WLAN protocol: 802.11 a/b/g/n/ac/ax, 2x2 MIMO, HE160, 1024QAM, 8 Spatial-stream Sounding MU-MIMO
2. WLAN frequency: 2.4GHz and 5GHz
3. WLAN direct connection: Supported
4. Bluetooth: BT5.2, support SBC, AAC, supports LDAC and L2HC high-definition audio
5. OTG: Support (Maximum output current 2A/9V during reverse power supply)
6. GPS: Support GPS (L1 + L5 dual-band) / AGPS / GLONASS / Beidou ((B1I+B1C+B2a+B2b quad-band) / GALILEO (E1 + E5a + E5b triple-band) / QZSS (L1 + L5 dual-band) / NavIC

Languages:
Arabic, Afrikaans, Bengali, Amharic, Bulgarian, Burmese, Dutch, Czech, Danish, French, English, Filipino, Finnish, Greek, German, Hindi, Hungarian, Hebrew, Indonesian, Italian, Japanese, Latvian, Malay, Norwegian, Portuguese, Polish, Russian, Romanian, Serbian, Swedish, Spanish, Turkish, Thai , Ukrainian, Vietnamese, Simplified Chinese, Traditional Chinese, Urdu, Zulu, Swahili, Estonian, Lithuanian, Slovak, Slovenian, Bosnian

Packing List:
1. Mobile phone x 1
2. Eject Pin x 1
3. Protective case x 1
4. Type-C USB cable x 1
5. US power adapter x 1
(Note: Subject to actual product)

Specification:

Package Weight

One Package Weight

0.79kgs / 1.75lb

One Package Size

20cm * 20cm * 5cm / 7.87inch * 7.87inch * 1.97inch

Qty per Carton

20

Carton Weight

16.80kgs / 37.04lb

Carton Size

42cm * 42cm * 26cm / 16.54inch * 16.54inch * 10.24inch

Loading Container

20GP: 581 cartons * 20 pcs = 11620 pcs
40HQ: 1349 cartons * 20 pcs = 26980 pcs

Còn hàng

Receives in 7 days.

HOTWAV W11 Điện thoại bền bỉ, Tầm nhìn ban đêm, Pin 20800mAh, Màn hình 6.6 inch Android 13 MT8788 Octa Core, Mạng: 4G, OTG, Ghi âm cuộc gọi, 6GB+256GB

HOTWAV

HOTWAV W11 Điện thoại bền bỉ, Tầm nhìn ban đêm, Pin 20800mAh, Màn hình 6.6 inch Android 13 MT8788 Octa Core, Mạng: 4G, OTG, Ghi âm cuộc gọi, 6GB+256GB

6.882.000 VND 7.308.000 VND

-6%

Platform:
1. Chipset: MT 8788
2. CPU: A73 2.0GHZx4+A55 2.0GHZx4, 12nm
3. GPU: Mail-G72 800MHz
4. OS: Android 13.0

Memory:
1. RAM: 6GB + 6GB virtual RAM
2. ROM: 256GB
3. T-flash Card: Up to 2TB (not included)

Display Screen:
1. Size: 6.6 inch
2. Type: INCELL
3. Resolution: 1080 x 2460
4. Screen Brightness: 450/480 nits
5. Aspect Ratio: 19.5:9
6. Contrast: 1500

Netwrok:
1. 2G: B2/B3/B5/B8
2. 3G: B1/B2/B5/B8
3. 4G: FDD: B1/B2/B3/B4/B5/B7/B8/B12/B13/B17/B18/B19/B20/B25/B26/B28A/B28B/B66; TDD: B41

Body
1. SIM: Two SIM / nano
2. Dimensions: 176.6x84.8x26.5mm
3. Weight: 550g
4. Build: Front cover: In mold injection hardware
5. Back cover: Plastic
6. Middle frame decoration: Aluminum alloy
7. Side key: Aluminum alloy

Cameras:
1. Front Camera: 16MP S5K3P3SP 1/2 inch F2.2, 80 degree Wide Angle
2. Rear Camera: 64MP IMX686 PDAF 1/2 inch F1.8, 80 degree Wide Angle
3. Rear Sub Camera: 24MP night vision FF 1/2.8 inch F1.8, 80 degree Wide Angle

Battery:
1. Capacity: 20800mAh polymer
2. Standby time: 2500H
3. Talk time: 120H
4. Music Play time: 200H
5. Charging Power: 9V 3A

Others:
1. Features: Fingerprint ID, Face ID, GPS (GPS+GLONASS+Galileo), Wi-Fi(2.4+5G, WLAN Hotspot), Bluetooth(V4.2), FM, OTG, NFC
2. Sensors: G-sensor, Proximity Sensor, Ambient Light Senor, Compass (magnetic), Geomagnetism, Hard Coulometer, Rapid Charge, Sound Amplifier, Smart Gesture, Air Gesture
3. Video Playback: Support AVI, MP4, WMV, RMVB, MKV, MOV, ASF, RM, FLV and other video formats, up to 1080p / 30fps
4. Audioplayer: Support MP3, M4A, AAC, MKA, AMRAnd other video formats / supports lossless format: ALAC(Apple Lossless), FLAC, APE, WAV
5. Graphic Format: Support JPEG, BMP, GIF, PNG etc.
6. Language: Arabic, Bengali, Bulgarian, Burmese, Dutch, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hindi, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Norwegian, Persian, Portuguese, Polish, Romanian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Swahili, Lithuanian, Slovak, Slovenian, Bosnian

Package List:
1. Phone x 1
2. User Manual x 1
3. USB Cable x 1
4. Warranty Card x 1
5. EU Plug Power Adapter x 1
6. Package Box x 1

Specification:

Package Weight

One Package Weight

1.00kgs / 2.20lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

18.00kgs / 39.68lb

Carton Size

42cm * 32cm * 25cm / 16.54inch * 12.6inch * 9.84inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

HOTWAV T7 Điện thoại bền bỉ, Pin 6280mAh, Màn hình 6.52 inch Android 13 MT8788 Octa Core, Mạng: 4G, OTG, 4GB+128GB

HOTWAV

HOTWAV T7 Điện thoại bền bỉ, Pin 6280mAh, Màn hình 6.52 inch Android 13 MT8788 Octa Core, Mạng: 4G, OTG, 4GB+128GB

4.406.000 VND

Platform:
1. Chipset: MT 8788
2. CPU: A73 2.0GHZx4+A55 2.0GHZx4
3. GPU: Mail-G72 800MHz
4. OS: Android 13.0

Memory:
1. RAM: 4GB + 4GB virtual RAM
2. ROM:128GB
3. T-flash Card: Up to 2TB (not included)

Display Screen:
1. Size: 6.52 inch
2. Type: INCELL
3. Resolution: 720 x 1280
4. Screen Brightness: 420/450 nits
5. Aspect Ratio: 19.5:9
6. Contrast: 1500

Netwrok:
1. 2G: B2/B3/B5/B8
2. 3G: B1/B2/B4/B5/B6/B8/B19
3. 4G: FDD: B1/B2/B3/B4/B5/B7/B8/ B12/B13/B17/B18/B19/B20/B26/B28A/ B28B/B66; TDD: B38/B39/B40/B41

Body:
1. SIM: Two SIM / nano
2. Dimensions: 174.6x82.8x12.8mm
3. Weight: 310g
4. Build: Front cover: In mold injection hardware
5. Back cover: Plastic
6. Middle frame decoration: Aluminum alloy
7. Side key: Aluminum alloy

Cameras:
1. Front Camera: 8MP HI849 FF 1/5 inch F2.4, 80 degree Wide Angle
2. Rear Camera: 20MP IMX220 PDAF 1/2.3 inch F1.8, 80 degree Wide Angle

Battery:
1. Capacity: 6280mAh polymer
2. Standby time: 1200H
3. Talk time: 30H
4. Music Play time: 65H
5. Charging Power: 5V2A

Others:
1. Features: Face ID, GPS (GPS+GLONASS+Galileo), Wi-Fi(2.4+5G, WLAN Hotspot), Bluetooth(V5.0), FM, OTG,
2. Sensors: G-sensor, Proximity Sensor, Ambient Light Senor, Compass (magnetic), Hard Coulometer, Rapid Charge, Sound Amplifier, Smart Gesture, Air Gesture
3. Video Playback: Support AVI, MP4, WMV, RMVB, MKV, MOV, ASF, RM, FLV and other video formats, up to 1080p / 30fps
4. Audioplayer: Support MP3, M4A, AAC, MKA, AMRAnd other video formats / supports lossless format: ALAC(Apple Lossless), FLAC, APE, WAV
5. Graphic Format: Support JPEG, BMP, GIF,PNG etc.
6. Language: Arabic, Bengali, Bulgarian, Burmese, Dutch, Czech, Danish, English, French, Finnish, Filipino, Greek, German, Hindi, Hebrew, Indonesian, Italian, Japanese, Malay, Latvian, Norwegian, Persian, Portuguese, Polish, Romanian, Swedish, Spanish, Turkish, Thai, UKrainian, Vietnamese, Traditional Chinese, Swahili, Lithuanian, Slovak, Slovenian, Bosnian

Package List:
1. Phone x 1
2. User Manual x 1
3. USB Cable x 1
4. Warranty Card x 1
5. EU Plug Power Adapter x 1
6. Package Box x 1

Specification:

General

Certificate

MSDS, ROHS, FCC

Package Weight

One Package Weight

0.55kgs / 1.21lb

One Package Size

20cm * 12cm * 6cm / 7.87inch * 4.72inch * 2.36inch

Qty per Carton

20

Carton Weight

16.00kgs / 35.27lb

Carton Size

42cm * 32cm * 25cm / 16.54inch * 12.6inch * 9.84inch

Loading Container

20GP: 793 cartons * 20 pcs = 15860 pcs
40HQ: 1842 cartons * 20 pcs = 36840 pcs

Còn hàng

Receives in 7 days.

Unihertz Tank 3 Pro 5G / 8849, Máy chiếu, Camera 200MP, Tầm nhìn ban đêm, Pin 23800mAh, Màn hình 6.79 inch Android 13 Dimensity 8200 Octa Core, Mạng: 5G, 16GB+512GB

Unihertz

Unihertz Tank 3 Pro 5G / 8849, Máy chiếu, Camera 200MP, Tầm nhìn ban đêm, Pin 23800mAh, Màn hình 6.79 inch Android 13 Dimensity 8200 Octa Core, Mạng: 5G, 16GB+512GB

15.790.000 VND 21.359.000 VND

-26%

Còn hàng

Receives in 7 days.

HAMTOD T8 Điện thoại gập 4G, Màn hình 2.8 inch + 1.77 inch, VoLTE, BT, SOS, OTG, Phiên bản EU

HAMTOD

HAMTOD T8 Điện thoại gập 4G, Màn hình 2.8 inch + 1.77 inch, VoLTE, BT, SOS, OTG, Phiên bản EU

1.297.000 VND 1.693.000 VND

-23%

1. CPU: T107, ARM CortexTM A7, quad-core, 1.0GHz
2. Memory: ROM 128MB + RAM 48MB
3. Storage Extend: TF card up to 64GB (not included)
4. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
5. Charge Port: Type-C
6. Headphone Jack: 3.5mm
7. Battery: 1500mAh li-ion removable battery
8. Features: FM Radio, OTG (reverse charging), SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 107.3 x 56.2 x 20.3mm

Display Screen:
1. Size: 2.8 inch inner screen, 1.77 inch outer screen
2. Screen resolution: 240 x 320 px inner screen,160 x 128px outer screen

Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)

Languages:
1. European languages: Finnish, Swedish, Norwegian, Icelandic, Danish, Spanish, Portuguese, Italian, Greek, Slovenian, Croatian, Romanian, Bulgarian, Serbian, English, French, Irish , Dutch, German, Swiss, Polish, Czech, Hungarian, Slovak, Estonian, Latvian, Lithuanian, Russian
2. US language: Costa Rican, Cuban, Honduran, Canadian English, US English, Mexican, Dominican, Grenadian, Haitian, Nicaraguan, Salvadoran, Saint Kitts and Nevis, Saint Lucia English, Saint Vincent and the Grenadines, Trinidad and Tobago, Guatemalan, Jamaican

Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide x 1

Specification:

General

Certificate

CE, MSDS, ROHS, RED

Package Weight

One Package Weight

0.33kgs / 0.74lb

One Package Size

16cm * 10cm * 5.5cm / 6.3inch * 3.94inch * 2.17inch

Qty per Carton

40

Carton Weight

14.00kgs / 30.86lb

Carton Size

42cm * 33cm * 25cm / 16.54inch * 12.99inch * 9.84inch

Loading Container

20GP: 769 cartons * 40 pcs = 30760 pcs
40HQ: 1786 cartons * 40 pcs = 71440 pcs

Còn hàng

Receives in 7 days.

Màn hình 3.0 inch Android 9.0 MTK6737 Quad Core, Bluetooth, WiFi, Mạng: 3G, Dual SIM, SOYES XS15 Pro

SOYES

Màn hình 3.0 inch Android 9.0 MTK6737 Quad Core, Bluetooth, WiFi, Mạng: 3G, Dual SIM, SOYES XS15 Pro

1.073.000 VND 1.378.000 VND

-22%

Features
1. Ultra slim and lightweight body.
2. MTK6737 Quad core CPU, high performance, combine with 2GB+16GB memory, run fast and operate smoothly..
3. 3.0 inch screen, 326PPI, 854x480px resolution display.
4. 4MP front camera, 6MP rear cameras take high quality pictures.
5. Built-in 1000mAh polymer battery non-removable battery, the battery will make the phone last for several days in normal use.

Specifications
General:
1. Model: XS15 Pro
2. CPU: MTK6737 Quad Core
3. Memory: 2GB+16GB
4. SIM Quantity: Dual SIM, Nano SIM Card
5. OS System: Android 9.0
6. External Memory: TF card up to 128GB (not included)
7. Support Language: Arabic, Burmese, Cambodian, English, French, Filipino, German, India, Indonesian, Italian, Malay, Persian, Portuguese, Russian, Spanish, Turkish, Thai, Vietnamese
8. Battery Capacity: 1000mAh
9. Battery Types: Undetachable, Li-polymer Battery
10. Other Features: calculator, alarm clock, calendar, memo, timer on/off, keyboard lock, U disk function
11. Size: 94x47.4x12.5mm

Network Connection:
1. 3G: WCDMA 850(B5)/900(B8)/1900(B2)/2100(B1)MHz
2. 2G: GSM 850/900/1800/1900MHz
3. Type: WCDMA, GSM
4. WIFI:802.11a/b/g/n, 2.4GHz
5. BT:Yes, V4.0

Screen Display:
1. Screen Size: 3.0 inch
2. Screen Type: Capacitive
3. Resolution: 854 x 480 pixels
4. PPI: 326PPI

Cameras:
1. Front Camera: 4MP
2. Back Camera: 6MP
3. Video recording: Yes

Connectivity Ports:
1. USB Charging Port: Type C
2. 2 x Nano SIM card or (1 x Nano SIM card + 1 x TF card) slots

Package List
1. Phone x 1
2. Screen Protector x 1
3. Eject Pin x 1
4. Protective Case x 1
5. USB Cable x 1
6. Manual x 1

Specification:

Package Weight

One Package Weight

0.20kgs / 0.43lb

One Package Size

12cm * 7cm * 5cm / 4.72inch * 2.76inch * 1.97inch

Qty per Carton

40

Carton Weight

8.80kgs / 19.40lb

Carton Size

30cm * 23cm * 24cm / 11.81inch * 9.06inch * 9.45inch

Loading Container

20GP: 1610 cartons * 40 pcs = 64400 pcs
40HQ: 3738 cartons * 40 pcs = 149520 pcs

Còn hàng

Receives in 7 days.

Menu chính

Menu ngăn kéo

So sánh sản phẩm

Mô tả bộ sưu tập

Menu chính

Menu ngăn kéo

TỐI ƯU HÓA BF

Khám phá Bộ sưu tập Liên quan

Mô tả bộ sưu tập